The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-bromo-4-methoxybenzyl)-5-(3,5-dibromo-4-(4-morpholinobutoxy)phenyl)pyrazin-2(1H)-one ID: ALA2417886
PubChem CID: 72163846
Max Phase: Preclinical
Molecular Formula: C26H28Br3N3O4
Molecular Weight: 686.24
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2nc(-c3cc(Br)c(OCCCCN4CCOCC4)c(Br)c3)c[nH]c2=O)cc1Br
Standard InChI: InChI=1S/C26H28Br3N3O4/c1-34-24-5-4-17(12-19(24)27)13-22-26(33)30-16-23(31-22)18-14-20(28)25(21(29)15-18)36-9-3-2-6-32-7-10-35-11-8-32/h4-5,12,14-16H,2-3,6-11,13H2,1H3,(H,30,33)
Standard InChI Key: BFZIYAZYUKUKHG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
11.4159 -25.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4159 -26.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1212 -27.0127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8265 -26.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8265 -25.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1212 -25.3783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5317 -25.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2385 -25.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9469 -25.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9498 -24.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2383 -24.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5328 -24.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7070 -25.3845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7046 -24.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4145 -24.1563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4124 -23.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7030 -22.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9942 -23.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9997 -24.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7088 -27.0179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2378 -23.3474 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
15.6533 -25.8041 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
15.6581 -24.1676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3652 -24.5773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0736 -24.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7806 -24.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4890 -24.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1960 -24.5819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1924 -25.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8954 -25.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6062 -25.4056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6095 -24.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9020 -24.1733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1192 -22.9295 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
10.6995 -22.1153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4055 -21.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
1 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
2 20 2 0
11 21 1 0
9 22 1 0
10 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
16 34 1 0
17 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 686.24Molecular Weight (Monoisotopic): 682.9630AlogP: 5.82#Rotatable Bonds: 10Polar Surface Area: 76.68Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.81CX Basic pKa: 7.49CX LogP: 5.17CX LogD: 4.82Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -0.67
References 1. Saha S, Reddy ChV, Xu S, Sankar S, Neamati N, Patro B.. (2013) Synthesis and SAR studies of marine natural products ma'edamines A, B and their analogues., 23 (18): [PMID:23927972 ] [10.1016/j.bmcl.2013.07.017 ]