5-(4-(4-(dimethylamino)butoxy)phenyl)-3-(4-methoxybenzyl)pyrazin-2(1H)-one

ID: ALA2417888

PubChem CID: 72163953

Max Phase: Preclinical

Molecular Formula: C24H29N3O3

Molecular Weight: 407.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cc2nc(-c3ccc(OCCCCN(C)C)cc3)c[nH]c2=O)cc1

Standard InChI:  InChI=1S/C24H29N3O3/c1-27(2)14-4-5-15-30-21-12-8-19(9-13-21)23-17-25-24(28)22(26-23)16-18-6-10-20(29-3)11-7-18/h6-13,17H,4-5,14-16H2,1-3H3,(H,25,28)

Standard InChI Key:  NIOMDUZAMIGLIR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    5.0063  -28.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0063  -28.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7116  -29.2909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4169  -28.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4169  -28.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7116  -27.6566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1222  -27.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8289  -28.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5374  -27.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5402  -26.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8287  -26.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1232  -26.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2974  -27.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2950  -26.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0049  -26.4345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0029  -25.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2934  -25.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5846  -25.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5901  -26.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2992  -29.2961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2486  -26.4458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9556  -26.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6640  -26.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3710  -26.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0794  -26.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7864  -26.8601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7829  -27.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4924  -26.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2899  -24.3936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9959  -23.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
  1 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  2 20  2  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 17 29  1  0
 29 30  1  0
M  END

Associated Targets(Human)

CAMA-1 (145 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
T47D (39041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-BR-3 (5175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 407.51Molecular Weight (Monoisotopic): 407.2209AlogP: 3.76#Rotatable Bonds: 10
Polar Surface Area: 67.45Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.85CX Basic pKa: 9.75CX LogP: 2.83CX LogD: 0.73
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -0.67

References

1. Saha S, Reddy ChV, Xu S, Sankar S, Neamati N, Patro B..  (2013)  Synthesis and SAR studies of marine natural products ma'edamines A, B and their analogues.,  23  (18): [PMID:23927972] [10.1016/j.bmcl.2013.07.017]

Source