The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(3-carbamoylphenylcarbamoyl)-6-methoxypyridin-3-yl)-5-((S)-1-hydroxy-3,3-dimethylbutan-2-ylcarbamoyl)benzoic acid ID: ALA2417910
PubChem CID: 71660643
Max Phase: Preclinical
Molecular Formula: C28H30N4O7
Molecular Weight: 534.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(C(=O)N[C@H](CO)C(C)(C)C)cc2C(=O)O)c(C(=O)Nc2cccc(C(N)=O)c2)n1
Standard InChI: InChI=1S/C28H30N4O7/c1-28(2,3)21(14-33)31-25(35)16-8-9-18(20(13-16)27(37)38)19-10-11-22(39-4)32-23(19)26(36)30-17-7-5-6-15(12-17)24(29)34/h5-13,21,33H,14H2,1-4H3,(H2,29,34)(H,30,36)(H,31,35)(H,37,38)/t21-/m1/s1
Standard InChI Key: QOJVSMMGUMUYEI-OAQYLSRUSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
5.4183 -16.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4183 -17.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1328 -18.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8473 -17.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8473 -16.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1328 -16.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5617 -18.0954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2762 -17.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9907 -18.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2762 -16.8579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9907 -18.9204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7051 -19.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4196 -18.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4196 -18.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7051 -17.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7051 -16.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4196 -16.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4196 -15.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7051 -15.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9907 -15.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9907 -16.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1341 -16.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1341 -17.6829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8485 -16.4454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7051 -14.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4196 -13.9704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9907 -13.9704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1341 -14.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8485 -13.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5630 -14.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8485 -13.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5648 -13.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7051 -20.1579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9907 -20.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1341 -15.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8485 -15.6204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1328 -15.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8473 -15.2079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4183 -15.2079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
17 22 1 0
22 23 2 0
22 24 1 0
19 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
12 33 1 0
33 34 1 0
28 35 1 1
35 36 1 0
6 37 1 0
37 38 2 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.57Molecular Weight (Monoisotopic): 534.2114AlogP: 2.94#Rotatable Bonds: 9Polar Surface Area: 180.94Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.40CX Basic pKa: ┄CX LogP: 2.89CX LogD: -0.51Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -0.89
References 1. Bolton SA, Sutton JC, Anumula R, Bisacchi GS, Jacobson B, Slusarchyk WA, Treuner UD, Wu SC, Zhao G, Pi Z, Sheriff S, Smirk RA, Bisaha S, Cheney DL, Wei A, Schumacher WA, Hartl KS, Liu E, Zahler R, Seiler SM.. (2013) Discovery of nonbenzamidine factor VIIa inhibitors using a biaryl acid scaffold., 23 (18): [PMID:23927973 ] [10.1016/j.bmcl.2013.06.028 ]