The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-amino-3-hydroxy-1-oxobutan-2-yl)-6-(4-(3-(1-(2-(biphenyl-4-yl)acetyl)piperidin-4-yl)propyl)piperidin-1-yl)nicotinamide ID: ALA2418934
PubChem CID: 73349156
Max Phase: Preclinical
Molecular Formula: C37H47N5O4
Molecular Weight: 625.81
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(O)C(NC(=O)c1ccc(N2CCC(CCCC3CCN(C(=O)Cc4ccc(-c5ccccc5)cc4)CC3)CC2)nc1)C(N)=O
Standard InChI: InChI=1S/C37H47N5O4/c1-26(43)35(36(38)45)40-37(46)32-14-15-33(39-25-32)41-20-16-27(17-21-41)6-5-7-28-18-22-42(23-19-28)34(44)24-29-10-12-31(13-11-29)30-8-3-2-4-9-30/h2-4,8-15,25-28,35,43H,5-7,16-24H2,1H3,(H2,38,45)(H,40,46)
Standard InChI Key: VWWKCCKKPVCFSR-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 50 0 0 0 0 0 0 0 0999 V2000
13.2462 -12.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5526 -11.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8316 -12.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1380 -11.5684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8040 -12.8174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1707 -10.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4812 -10.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7579 -10.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7283 -11.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4221 -11.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0660 -10.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3434 -10.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6516 -10.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9290 -10.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2371 -10.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5168 -10.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4820 -11.3457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1736 -11.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9001 -11.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7621 -11.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0716 -11.2835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3481 -11.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3139 -12.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0092 -12.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7298 -12.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5905 -12.8593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8997 -12.4227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5578 -13.6758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1762 -12.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4854 -12.3662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1436 -13.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4201 -13.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8344 -14.0558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5180 -11.5496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2407 -12.7462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2140 -12.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9067 -13.2971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6287 -12.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6538 -12.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9604 -11.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3228 -13.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2910 -14.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9843 -14.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7059 -14.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7298 -13.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0359 -12.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
4 6 1 0
4 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
23 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
29 31 1 0
31 32 1 0
31 33 1 0
30 34 2 0
30 35 1 0
1 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 1 1 0
38 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 625.81Molecular Weight (Monoisotopic): 625.3628AlogP: 4.58#Rotatable Bonds: 12Polar Surface Area: 128.86Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.87CX LogP: 4.30CX LogD: 4.29Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.27Np Likeness Score: -0.96
References 1. Norman DD, Ibezim A, Scott WE, White S, Parrill AL, Baker DL.. (2013) Autotaxin inhibition: development and application of computational tools to identify site-selective lead compounds., 21 (17): [PMID:23816044 ] [10.1016/j.bmc.2013.05.061 ]