Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

(E)-N-(3-Hydroxy-4-(3-(5-methylthiophen-2-yl)acryloyl)phenyl)acetamide

ID: ALA2419917

PubChem CID: 71817630

Max Phase: Preclinical

Molecular Formula: C16H15NO3S

Molecular Weight: 301.37

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc(C(=O)/C=C/c2ccc(C)s2)c(O)c1

Standard InChI:  InChI=1S/C16H15NO3S/c1-10-3-5-13(21-10)6-8-15(19)14-7-4-12(9-16(14)20)17-11(2)18/h3-9,20H,1-2H3,(H,17,18)/b8-6+

Standard InChI Key:  HWSVAFZQHWDOIN-SOFGYWHQSA-N

Molfile:  

     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
   10.5220  -14.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2364  -14.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5220  -13.6378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8075  -14.8753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0930  -14.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3785  -14.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6641  -14.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6641  -13.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3785  -13.2253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0930  -13.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9496  -13.2253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2351  -13.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5207  -13.2253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9496  -12.4003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8062  -13.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7200  -14.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9130  -14.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5005  -13.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0525  -13.3023    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.6800  -13.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9496  -14.8753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
 11 12  1  0
 12 13  2  0
 11 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 15 19  1  0
 18 20  1  0
 13 15  1  0
  8 11  1  0
  7 21  1  0
  4  5  1  0
M  END

Associated Targets(non-human)

Nr1h2 Oxysterols receptor LXR-beta (116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Calculated Properties

Molecular Weight: 301.37Molecular Weight (Monoisotopic): 301.0773AlogP: 3.62#Rotatable Bonds: 4
Polar Surface Area: 66.40Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.88CX Basic pKa: CX LogP: 4.03CX LogD: 3.41
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.67Np Likeness Score: -1.19

References

1. Hu Y, Yang Y, Yu Y, Wen G, Shang N, Zhuang W, Lu D, Zhou B, Liang B, Yue X, Li F, Du J, Bu X..  (2013)  Synthesis and identification of new flavonoids targeting liver X receptor β involved pathway as potential facilitators of Aβ clearance with reduced lipid accumulation.,  56  (15): [PMID:23844653] [10.1021/jm301913k]
2. Chen M, Yang F, Kang J, Gan H, Lai X, Gao Y..  (2018)  Discovery of molecular mechanism of a clinical herbal formula upregulating serum HDL-c levels in treatment of metabolic syndrome by in vivo and computational studies.,  28  (2): [PMID:29196136] [10.1016/j.bmcl.2017.11.033]

Source