The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N-Bis(4,6-dimethyl-3-oxo-2,3-dihydroisothiazolo5,4-b]pyridin-2-ylmethyl)-N-4-chlorobenzylamine ID: ALA2419958
PubChem CID: 71770925
Max Phase: Preclinical
Molecular Formula: C25H24ClN5O2S2
Molecular Weight: 526.09
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c2c(=O)n(CN(Cc3ccc(Cl)cc3)Cn3sc4nc(C)cc(C)c4c3=O)sc2n1
Standard InChI: InChI=1S/C25H24ClN5O2S2/c1-14-9-16(3)27-22-20(14)24(32)30(34-22)12-29(11-18-5-7-19(26)8-6-18)13-31-25(33)21-15(2)10-17(4)28-23(21)35-31/h5-10H,11-13H2,1-4H3
Standard InChI Key: LILXHXILNRDJTM-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
15.7940 -11.3044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6187 -11.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0310 -12.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6187 -12.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0310 -13.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8557 -13.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2679 -12.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8557 -12.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3817 -12.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2881 -11.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2881 -12.4281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5768 -12.8404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8612 -12.4281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8612 -11.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5768 -11.1912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0724 -11.3506 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.5570 -12.0158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0724 -12.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3295 -13.4694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1456 -11.1912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5768 -13.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3817 -10.5888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7883 -8.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0727 -8.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0727 -7.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7883 -7.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5039 -7.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5039 -8.5704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6159 -9.7885 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.7940 -9.8732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4607 -9.1191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6550 -8.9510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2152 -7.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3572 -7.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2682 -14.1609 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
3 8 2 0
1 2 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 0
17 18 1 0
10 16 1 0
11 18 1 0
9 17 1 0
18 19 2 0
14 20 1 0
12 21 1 0
1 9 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
29 30 1 0
30 31 1 0
23 29 1 0
24 31 1 0
22 30 1 0
31 32 2 0
27 33 1 0
25 34 1 0
1 22 1 0
6 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.09Molecular Weight (Monoisotopic): 525.1060AlogP: 5.23#Rotatable Bonds: 6Polar Surface Area: 73.02Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.14CX LogP: 5.60CX LogD: 5.60Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -0.93
References 1. Malinka W, Swiątek P, Sliwińska M, Szponar B, Gamian A, Karczmarzyk Z, Fruziński A.. (2013) Synthesis of novel isothiazolopyridines and their in vitro evaluation against Mycobacterium and Propionibacterium acnes., 21 (17): [PMID:23850103 ] [10.1016/j.bmc.2013.06.027 ]