The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N-Bis(4,6-dimethyl-3-oxo-2,3-dihydroisothiazolo5,4-b]pyridin-2-ylmethyl)-N-2-methoxybenzylamine ID: ALA2419959
PubChem CID: 16662764
Max Phase: Preclinical
Molecular Formula: C26H27N5O3S2
Molecular Weight: 521.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1CN(Cn1sc2nc(C)cc(C)c2c1=O)Cn1sc2nc(C)cc(C)c2c1=O
Standard InChI: InChI=1S/C26H27N5O3S2/c1-15-10-17(3)27-23-21(15)25(32)30(35-23)13-29(12-19-8-6-7-9-20(19)34-5)14-31-26(33)22-16(2)11-18(4)28-24(22)36-31/h6-11H,12-14H2,1-5H3
Standard InChI Key: CDNSDMJKJLJRPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
15.8005 -11.3090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6255 -11.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0380 -12.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6255 -12.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0380 -13.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8630 -13.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2754 -12.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8630 -12.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3880 -12.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2936 -11.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2936 -12.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5820 -12.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8661 -12.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8661 -11.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5820 -11.1957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0782 -11.3553 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.5630 -12.0207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0782 -12.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3353 -13.4749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1502 -11.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5820 -13.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3880 -10.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7952 -8.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0793 -8.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0793 -7.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7952 -7.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5111 -7.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5111 -8.5740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6228 -9.7925 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.8005 -9.8773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4670 -9.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6610 -8.9547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2227 -7.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3635 -7.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2757 -11.3064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1007 -11.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
3 8 2 0
1 2 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 0
17 18 1 0
10 16 1 0
11 18 1 0
9 17 1 0
18 19 2 0
14 20 1 0
12 21 1 0
1 9 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
29 30 1 0
30 31 1 0
23 29 1 0
24 31 1 0
22 30 1 0
31 32 2 0
27 33 1 0
25 34 1 0
1 22 1 0
8 35 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.67Molecular Weight (Monoisotopic): 521.1555AlogP: 4.59#Rotatable Bonds: 7Polar Surface Area: 82.25Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.95CX LogP: 4.84CX LogD: 4.84Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -0.76
References 1. Malinka W, Swiątek P, Sliwińska M, Szponar B, Gamian A, Karczmarzyk Z, Fruziński A.. (2013) Synthesis of novel isothiazolopyridines and their in vitro evaluation against Mycobacterium and Propionibacterium acnes., 21 (17): [PMID:23850103 ] [10.1016/j.bmc.2013.06.027 ]