The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-Bis((4-methoxybenzyl)thio)naphthalene-1,4-dione ID: ALA2424729
PubChem CID: 73349199
Max Phase: Preclinical
Molecular Formula: C26H22O4S2
Molecular Weight: 462.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CSC2=C(SCc3ccc(OC)cc3)C(=O)c3ccccc3C2=O)cc1
Standard InChI: InChI=1S/C26H22O4S2/c1-29-19-11-7-17(8-12-19)15-31-25-23(27)21-5-3-4-6-22(21)24(28)26(25)32-16-18-9-13-20(30-2)14-10-18/h3-14H,15-16H2,1-2H3
Standard InChI Key: QRTOPJGXZHTYCX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
8.6511 -9.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3602 -8.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3602 -7.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6511 -7.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9461 -7.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2370 -7.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5321 -7.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5321 -8.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2370 -9.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9461 -8.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6511 -9.8290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6511 -6.5602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0693 -7.3774 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.0693 -6.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7784 -6.1516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4833 -6.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1924 -6.1516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1924 -5.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4833 -4.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7784 -5.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9015 -4.9258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9015 -4.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0693 -9.0118 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.7784 -8.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4833 -9.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4833 -9.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1924 -10.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9015 -9.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9015 -9.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1924 -8.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6065 -10.2376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6065 -11.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
1 11 2 0
4 12 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 1 0
18 21 1 0
13 14 1 0
3 13 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
31 32 1 0
28 31 1 0
23 24 1 0
2 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.59Molecular Weight (Monoisotopic): 462.0960AlogP: 6.16#Rotatable Bonds: 8Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.18CX LogD: 5.18Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.34
References 1. Ibis C, Tuyun AF, Bahar H, Ayla SS, Stasevych MV, Musyanovych RY, Komarovska-Porokhnyavets O, Novikov V. (2013) Nucleophilic substitution reactions of 1,4-naphthoquinone and biologic properties of novel S-, S,S-, N-, and N,S-substituted 1,4-naphthoquinone derivatives, [10.1007/s00044-013-0806-y ]