The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(2-methoxy-benzylamino)-1-[4-(3-{1-[6-(2-methoxy-benzylamino)-hexanoyl]-piperidin-4-yl}-propyl)-piperidin-1-yl]-hexan-1-one ID: ALA242990
PubChem CID: 11296868
Max Phase: Preclinical
Molecular Formula: C41H64N4O4
Molecular Weight: 676.99
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1CNCCCCCC(=O)N1CCC(CCCC2CCN(C(=O)CCCCCNCc3ccccc3OC)CC2)CC1
Standard InChI: InChI=1S/C41H64N4O4/c1-48-38-18-9-7-16-36(38)32-42-26-11-3-5-20-40(46)44-28-22-34(23-29-44)14-13-15-35-24-30-45(31-25-35)41(47)21-6-4-12-27-43-33-37-17-8-10-19-39(37)49-2/h7-10,16-19,34-35,42-43H,3-6,11-15,20-33H2,1-2H3
Standard InChI Key: ZYVBLECRVSYZOD-UHFFFAOYSA-N
Molfile:
RDKit 2D
49 52 0 0 0 0 0 0 0 0999 V2000
16.7907 -24.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7918 -25.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0770 -26.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3606 -25.7737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3634 -24.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0788 -24.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0813 -23.7091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3680 -23.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6505 -24.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9345 -24.9378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2216 -24.5226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5056 -24.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7927 -24.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0766 -24.9271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3637 -24.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6477 -24.9217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9348 -24.5065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2203 -24.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5095 -24.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5083 -23.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2242 -23.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9412 -23.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6505 -23.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6306 -24.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6318 -25.7690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9169 -26.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2005 -25.7685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2034 -24.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9187 -24.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9212 -23.7039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2080 -23.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4904 -24.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7744 -24.9326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0615 -24.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3455 -24.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3674 -24.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0834 -24.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7964 -24.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5124 -24.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2253 -24.5013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9398 -24.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6506 -24.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9359 -23.2638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2188 -23.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3653 -23.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0794 -23.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7943 -23.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5155 -25.7415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6446 -25.7467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24 25 2 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 2 0
1 2 2 0
27 28 1 0
13 14 1 0
28 29 2 0
29 24 1 0
6 7 1 0
29 30 1 0
14 15 1 0
30 31 1 0
3 4 2 0
28 32 1 0
15 16 1 0
32 33 1 0
7 8 1 0
33 34 1 0
16 17 1 0
34 35 1 0
17 18 1 0
35 36 1 0
36 37 1 0
5 9 1 0
37 38 1 0
4 5 1 0
38 39 1 0
9 10 1 0
39 40 1 0
40 41 1 0
2 3 1 0
17 22 1 0
18 19 1 0
19 20 1 0
40 44 1 0
41 42 1 0
42 23 1 0
23 43 1 0
43 44 1 0
20 21 1 0
23 45 1 0
21 22 1 0
45 46 1 0
10 11 1 0
46 47 1 0
47 20 1 0
5 6 2 0
39 48 2 0
11 12 1 0
16 49 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 676.99Molecular Weight (Monoisotopic): 676.4928AlogP: 7.35#Rotatable Bonds: 22Polar Surface Area: 83.14Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.34CX LogP: 6.07CX LogD: 2.80Aromatic Rings: 2Heavy Atoms: 49QED Weighted: 0.13Np Likeness Score: -0.35
References 1. Tumiatti V, Minarini A, Milelli A, Rosini M, Buccioni M, Marucci G, Ghelardini C, Bellucci C, Melchiorre C.. (2007) Structure-activity relationships of methoctramine-related polyamines as muscarinic antagonist: effect of replacing the inner polymethylene chain with cyclic moieties., 15 (6): [PMID:17276075 ] [10.1016/j.bmc.2007.01.022 ]