2-(4-((1-phenyl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazole

ID: ALA2430638

PubChem CID: 73350888

Max Phase: Preclinical

Molecular Formula: C26H18N4O2

Molecular Weight: 418.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(-n2cc(COc3ccc(-c4nc5c(ccc6ccccc65)o4)cc3)nn2)cc1

Standard InChI:  InChI=1S/C26H18N4O2/c1-2-7-21(8-3-1)30-16-20(28-29-30)17-31-22-13-10-19(11-14-22)26-27-25-23-9-5-4-6-18(23)12-15-24(25)32-26/h1-16H,17H2

Standard InChI Key:  BLJDQJWGMYLFMQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
    0.6845   -9.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6833  -10.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4006  -10.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3988   -8.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1084   -9.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1092  -10.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8187  -10.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5362  -10.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8213   -8.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5343   -9.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1500   -8.6438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8082   -7.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9938   -7.9835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2591   -7.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0847   -7.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5355   -6.5721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1632   -5.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3359   -5.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8847   -6.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6256   -5.1409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4528   -5.1947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9069   -4.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7225   -4.3874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8604   -3.5805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1268   -3.1888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5376   -3.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0448   -2.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7184   -1.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6368   -1.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8767   -0.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2099   -1.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2907   -2.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Associated Targets(non-human)

Ptpn1 Protein-tyrosine phosphatase 1B (270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.46Molecular Weight (Monoisotopic): 418.1430AlogP: 5.81#Rotatable Bonds: 5
Polar Surface Area: 65.97Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.03CX LogP: 5.69CX LogD: 5.69
Aromatic Rings: 6Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -1.45

References

1. Madabhushi S, Chinthala N, Kanwal A, Kaur G, Banerjee SK.  (2013)  Synthesis and characterization of 2-(4-((1-alkyl or aryl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazoles for protein tyrosine phosphatase 1B inhibitory activity,  [10.1007/s00044-013-0784-0]

Source