2-(4-((1-(4-Methoxyphenyl)-1H-1,2,3-triazol-4yl)methoxy)phenyl)naphtho[1,2-d]oxazole

ID: ALA2430639

PubChem CID: 73353837

Max Phase: Preclinical

Molecular Formula: C27H20N4O3

Molecular Weight: 448.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2cc(COc3ccc(-c4nc5c(ccc6ccccc65)o4)cc3)nn2)cc1

Standard InChI:  InChI=1S/C27H20N4O3/c1-32-22-13-9-21(10-14-22)31-16-20(29-30-31)17-33-23-11-6-19(7-12-23)27-28-26-24-5-3-2-4-18(24)8-15-25(26)34-27/h2-16H,17H2,1H3

Standard InChI Key:  VANZBWORAVXINX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    1.2750  -10.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2739  -11.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9914  -12.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9896  -10.5774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6993  -10.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7000  -11.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4096  -12.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1273  -11.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4124  -10.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1255  -10.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7414  -10.4295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3994   -9.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5849   -9.7690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8505   -8.9962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6762   -9.0440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1271   -8.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7548   -7.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9273   -7.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4760   -8.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2173   -6.9258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0447   -6.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4989   -6.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3147   -6.1721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4526   -5.3651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7188   -4.9733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1294   -5.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6367   -4.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3106   -3.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2290   -2.8616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4687   -2.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8017   -3.0043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8825   -3.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3841   -1.7025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0510   -1.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  1  0
 33 34  1  0
M  END

Associated Targets(non-human)

Ptpn1 Protein-tyrosine phosphatase 1B (270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.48Molecular Weight (Monoisotopic): 448.1535AlogP: 5.82#Rotatable Bonds: 6
Polar Surface Area: 75.20Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.03CX LogP: 5.53CX LogD: 5.53
Aromatic Rings: 6Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.36

References

1. Madabhushi S, Chinthala N, Kanwal A, Kaur G, Banerjee SK.  (2013)  Synthesis and characterization of 2-(4-((1-alkyl or aryl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazoles for protein tyrosine phosphatase 1B inhibitory activity,  [10.1007/s00044-013-0784-0]

Source