2-(4-((1-(3-(Trifluoromethyl)phenyl)-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazole

ID: ALA2430640

PubChem CID: 73352374

Max Phase: Preclinical

Molecular Formula: C27H17F3N4O2

Molecular Weight: 486.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  FC(F)(F)c1cccc(-n2cc(COc3ccc(-c4nc5c(ccc6ccccc65)o4)cc3)nn2)c1

Standard InChI:  InChI=1S/C27H17F3N4O2/c28-27(29,30)19-5-3-6-21(14-19)34-15-20(32-33-34)16-35-22-11-8-18(9-12-22)26-31-25-23-7-2-1-4-17(23)10-13-24(25)36-26/h1-15H,16H2

Standard InChI Key:  MYKSHSOQSVIGCD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    9.1542  -10.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1531  -11.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8706  -11.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8688  -10.1615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5785  -10.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5792  -11.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2889  -11.8051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0065  -11.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2916  -10.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0047  -10.5706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6206  -10.0138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2787   -9.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4641   -9.3532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7297   -8.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5554   -8.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0063   -7.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6340   -7.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8065   -7.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3552   -7.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0965   -6.5099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9239   -6.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3781   -5.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1939   -5.7564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3318   -4.9493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5980   -4.5575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0086   -5.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5159   -3.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1898   -3.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1082   -2.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3479   -2.1055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6809   -2.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7617   -3.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7723   -1.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3801   -1.5252    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.6031   -2.1864    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.8235   -1.1042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 29 33  1  0
M  END

Associated Targets(non-human)

Ptpn1 Protein-tyrosine phosphatase 1B (270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.45Molecular Weight (Monoisotopic): 486.1304AlogP: 6.83#Rotatable Bonds: 5
Polar Surface Area: 65.97Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.03CX LogP: 6.57CX LogD: 6.57
Aromatic Rings: 6Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -1.66

References

1. Madabhushi S, Chinthala N, Kanwal A, Kaur G, Banerjee SK.  (2013)  Synthesis and characterization of 2-(4-((1-alkyl or aryl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazoles for protein tyrosine phosphatase 1B inhibitory activity,  [10.1007/s00044-013-0784-0]

Source