2-(4-((1-(3-Chlorophenyl)-1H-1,2,3-triazol-4yl)methoxyphenyl)naphtho[1,2-d]oxazole

ID: ALA2430641

PubChem CID: 73353838

Max Phase: Preclinical

Molecular Formula: C26H17ClN4O2

Molecular Weight: 452.90

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Clc1cccc(-n2cc(COc3ccc(-c4nc5c(ccc6ccccc65)o4)cc3)nn2)c1

Standard InChI:  InChI=1S/C26H17ClN4O2/c27-19-5-3-6-21(14-19)31-15-20(29-30-31)16-32-22-11-8-18(9-12-22)26-28-25-23-7-2-1-4-17(23)10-13-24(25)33-26/h1-15H,16H2

Standard InChI Key:  RCPGEKSDHHLNOV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   13.0322  -10.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0311  -11.7139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7485  -12.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7467  -10.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4563  -10.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4570  -11.7139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1666  -12.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8842  -11.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1693  -10.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8824  -10.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4982  -10.3328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1563   -9.5872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3419   -9.6723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6073   -8.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4329   -8.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8838   -8.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5116   -7.5215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6841   -7.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2329   -8.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9739   -6.8294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8012   -6.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2554   -6.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0712   -6.0758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2091   -5.2689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4753   -4.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8859   -5.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3932   -4.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0670   -3.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9854   -2.7657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2252   -2.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5583   -2.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6390   -3.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6688   -2.2863    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 29 33  1  0
M  END

Associated Targets(non-human)

Ptpn1 Protein-tyrosine phosphatase 1B (270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.90Molecular Weight (Monoisotopic): 452.1040AlogP: 6.46#Rotatable Bonds: 5
Polar Surface Area: 65.97Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.03CX LogP: 6.29CX LogD: 6.29
Aromatic Rings: 6Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -1.68

References

1. Madabhushi S, Chinthala N, Kanwal A, Kaur G, Banerjee SK.  (2013)  Synthesis and characterization of 2-(4-((1-alkyl or aryl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazoles for protein tyrosine phosphatase 1B inhibitory activity,  [10.1007/s00044-013-0784-0]

Source