2-(4-((1-(3-Chloro-4-fluorophenyl)-1H-1,2,3-triazol-4yl)methoxy)phenyl)naphtho[1,2-d]oxazole

ID: ALA2430642

PubChem CID: 73352375

Max Phase: Preclinical

Molecular Formula: C26H16ClFN4O2

Molecular Weight: 470.89

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1ccc(-n2cc(COc3ccc(-c4nc5c(ccc6ccccc65)o4)cc3)nn2)cc1Cl

Standard InChI:  InChI=1S/C26H16ClFN4O2/c27-22-13-19(8-11-23(22)28)32-14-18(30-31-32)15-33-20-9-5-17(6-10-20)26-29-25-21-4-2-1-3-16(21)7-12-24(25)34-26/h1-14H,15H2

Standard InChI Key:  ROBJXOLJEQGBHY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    5.0000  -10.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9989  -11.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7163  -11.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7145  -10.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4241  -10.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4248  -11.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1344  -11.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8520  -11.3027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1371  -10.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8502  -10.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4660   -9.9213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1241   -9.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3097   -9.2607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5751   -8.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4007   -8.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8515   -7.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4793   -7.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6519   -7.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2006   -7.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9417   -6.4178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7690   -6.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2232   -5.7838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0390   -5.6643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1769   -4.8573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4431   -4.4656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8537   -5.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3610   -3.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0348   -3.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9532   -2.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1930   -2.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5260   -2.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6068   -3.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6366   -1.8747    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.1084   -1.1950    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 29 33  1  0
 30 34  1  0
M  END

Associated Targets(non-human)

Ptpn1 Protein-tyrosine phosphatase 1B (270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.89Molecular Weight (Monoisotopic): 470.0946AlogP: 6.60#Rotatable Bonds: 5
Polar Surface Area: 65.97Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.03CX LogP: 6.43CX LogD: 6.43
Aromatic Rings: 6Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -1.87

References

1. Madabhushi S, Chinthala N, Kanwal A, Kaur G, Banerjee SK.  (2013)  Synthesis and characterization of 2-(4-((1-alkyl or aryl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazoles for protein tyrosine phosphatase 1B inhibitory activity,  [10.1007/s00044-013-0784-0]

Source