The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((1-(3,4-difluorophenyl)-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazole ID: ALA2430643
PubChem CID: 73346272
Max Phase: Preclinical
Molecular Formula: C26H16F2N4O2
Molecular Weight: 454.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc(-n2cc(COc3ccc(-c4nc5c(ccc6ccccc65)o4)cc3)nn2)cc1F
Standard InChI: InChI=1S/C26H16F2N4O2/c27-22-11-8-19(13-23(22)28)32-14-18(30-31-32)15-33-20-9-5-17(6-10-20)26-29-25-21-4-2-1-3-16(21)7-12-24(25)34-26/h1-14H,15H2
Standard InChI Key: MBUSAQGZMGUNJS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
0.2480 -14.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2469 -15.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9642 -15.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9625 -14.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6721 -14.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6729 -15.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3824 -15.6952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1000 -15.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3851 -14.0511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0982 -14.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7139 -13.9041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3721 -13.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5577 -13.2436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8231 -12.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6487 -12.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0996 -11.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7273 -11.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 -11.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4487 -11.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1897 -10.4006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0171 -10.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4712 -9.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2869 -9.6471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4249 -8.8402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6911 -8.4483 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1018 -9.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6091 -7.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2829 -7.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2013 -6.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4410 -5.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7741 -6.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8549 -7.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3523 -5.1737 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.8857 -5.8558 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 22 2 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
29 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.44Molecular Weight (Monoisotopic): 454.1241AlogP: 6.09#Rotatable Bonds: 5Polar Surface Area: 65.97Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.03CX LogP: 5.97CX LogD: 5.97Aromatic Rings: 6Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.78
References 1. Madabhushi S, Chinthala N, Kanwal A, Kaur G, Banerjee SK. (2013) Synthesis and characterization of 2-(4-((1-alkyl or aryl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazoles for protein tyrosine phosphatase 1B inhibitory activity, [10.1007/s00044-013-0784-0 ]