2-(4-((1-Hexyl-1H-1,2,3-triazol-4yl)methoxy)phenyl)naphtho[1,2-d]oxazole

ID: ALA2430645

PubChem CID: 73353840

Max Phase: Preclinical

Molecular Formula: C26H26N4O2

Molecular Weight: 426.52

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCn1cc(COc2ccc(-c3nc4c(ccc5ccccc54)o3)cc2)nn1

Standard InChI:  InChI=1S/C26H26N4O2/c1-2-3-4-7-16-30-17-21(28-29-30)18-31-22-13-10-20(11-14-22)26-27-25-23-9-6-5-8-19(23)12-15-24(25)32-26/h5-6,8-15,17H,2-4,7,16,18H2,1H3

Standard InChI Key:  RPHDMMWFPSUKGV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    7.8300  -11.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8288  -12.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5464  -12.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5446  -10.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2545  -11.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2553  -12.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9652  -12.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6830  -12.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9678  -10.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6811  -11.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2971  -10.7067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9551   -9.9608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1404  -10.0461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4063   -9.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2323   -9.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6832   -8.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3109   -7.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4832   -7.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0317   -8.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7735   -7.2021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6010   -7.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0554   -6.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8714   -6.4482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0094   -5.6410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2754   -5.2491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6859   -5.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1583   -4.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4000   -4.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2830   -3.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5163   -3.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3993   -2.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6368   -1.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Associated Targets(non-human)

Ptpn1 Protein-tyrosine phosphatase 1B (270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.52Molecular Weight (Monoisotopic): 426.2056AlogP: 6.40#Rotatable Bonds: 9
Polar Surface Area: 65.97Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.15CX LogP: 6.24CX LogD: 6.24
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -1.27

References

1. Madabhushi S, Chinthala N, Kanwal A, Kaur G, Banerjee SK.  (2013)  Synthesis and characterization of 2-(4-((1-alkyl or aryl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazoles for protein tyrosine phosphatase 1B inhibitory activity,  [10.1007/s00044-013-0784-0]

Source