The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((1-p-Tolyl-1H-1,2,3-triazol-4yl)methoxy)-phenyl)naphtho[1,2-d]oxazole ID: ALA2430648
PubChem CID: 73347771
Max Phase: Preclinical
Molecular Formula: C27H20N4O2
Molecular Weight: 432.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-n2cc(COc3ccc(-c4nc5c(ccc6ccccc65)o4)cc3)nn2)cc1
Standard InChI: InChI=1S/C27H20N4O2/c1-18-6-11-22(12-7-18)31-16-21(29-30-31)17-32-23-13-8-20(9-14-23)27-28-26-24-5-3-2-4-19(24)10-15-25(26)33-27/h2-16H,17H2,1H3
Standard InChI Key: YBJCRAVBJOTPRR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
5.7552 -14.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7540 -15.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4723 -15.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4705 -14.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1810 -14.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1817 -15.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8921 -15.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6106 -15.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8948 -14.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6088 -14.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2253 -13.9914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8830 -13.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0676 -13.3302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3345 -12.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1611 -12.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6125 -11.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2399 -11.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4115 -11.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9596 -11.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7028 -10.4838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5311 -10.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9858 -9.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8025 -9.7294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9406 -8.9215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2060 -8.5292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6159 -9.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0888 -7.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7397 -7.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6230 -6.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8573 -6.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2076 -6.5986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3277 -7.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7391 -5.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 22 2 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.48Molecular Weight (Monoisotopic): 432.1586AlogP: 6.12#Rotatable Bonds: 5Polar Surface Area: 65.97Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.03CX LogP: 6.20CX LogD: 6.20Aromatic Rings: 6Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.51
References 1. Madabhushi S, Chinthala N, Kanwal A, Kaur G, Banerjee SK. (2013) Synthesis and characterization of 2-(4-((1-alkyl or aryl-1H-1,2,3-triazol-4-yl)methoxy)phenyl)naphtho[1,2-d]oxazoles for protein tyrosine phosphatase 1B inhibitory activity, [10.1007/s00044-013-0784-0 ]