6-(4-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)pyridin-2(1H)-one

ID: ALA2431554

PubChem CID: 71699328

Max Phase: Preclinical

Molecular Formula: C20H18N2O6

Molecular Weight: 382.37

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(-n2c(-c3ccc([N+](=O)[O-])cc3)cccc2=O)cc(OC)c1OC

Standard InChI:  InChI=1S/C20H18N2O6/c1-26-17-11-15(12-18(27-2)20(17)28-3)21-16(5-4-6-19(21)23)13-7-9-14(10-8-13)22(24)25/h4-12H,1-3H3

Standard InChI Key:  IEYRCIGYZNTXIM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   34.3536   -2.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3525   -2.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0605   -3.2384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7702   -2.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7674   -2.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0587   -1.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0603   -4.0556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3525   -4.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6445   -3.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9371   -2.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6458   -1.6015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6456   -0.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4735   -1.5951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1863   -2.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8903   -1.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8915   -0.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1824   -0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4722   -0.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7642   -0.3694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1890   -2.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4825   -3.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4848   -4.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1944   -4.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9031   -4.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8972   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1982   -5.2642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9102   -5.6734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4948   -5.6800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  2  9  1  0
  9 10  1  0
  1 11  1  0
 11 12  1  0
  5 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 14 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  2  0
 26 28  1  0
M  CHG  2  26   1  28  -1
M  END

Associated Targets(Human)

HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-OV-3 (52876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

H22 (575 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 382.37Molecular Weight (Monoisotopic): 382.1165AlogP: 3.44#Rotatable Bonds: 6
Polar Surface Area: 92.83Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.66CX LogD: 2.66
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: -0.77

References

1. Chen T, Luo Y, Hu Y, Yang B, Lu W..  (2013)  Synthesis and biological evaluation of novel 1,6-diaryl pyridin-2(1H)-one analogs.,  64  [PMID:23708235] [10.1016/j.ejmech.2013.04.008]

Source