The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-(1H-Indol-3-yl)-1-oxo-1-(pyridin-4-ylamino)propan-2-yl)-2,4-difluorobenzamide ID: ALA2431631
PubChem CID: 72704298
Max Phase: Preclinical
Molecular Formula: C23H18F2N4O2
Molecular Weight: 420.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)Nc1ccncc1)c1ccc(F)cc1F
Standard InChI: InChI=1S/C23H18F2N4O2/c24-15-5-6-18(19(25)12-15)22(30)29-21(23(31)28-16-7-9-26-10-8-16)11-14-13-27-20-4-2-1-3-17(14)20/h1-10,12-13,21,27H,11H2,(H,29,30)(H,26,28,31)/t21-/m0/s1
Standard InChI Key: IPAPEESTIBMGFN-NRFANRHFSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
7.2003 -6.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9868 -5.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1899 -5.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9764 -4.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5597 -4.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3566 -4.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5702 -5.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0073 -6.7217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6483 -7.1632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3462 -3.3626 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6065 -6.1231 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3199 -8.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9032 -7.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7102 -8.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5334 -9.3281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5698 -10.2813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1531 -9.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9500 -9.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1635 -10.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5802 -11.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7833 -11.0782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5230 -8.3177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9651 -10.2389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4802 -9.5714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9651 -8.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7498 -9.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4642 -8.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1787 -9.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1787 -9.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4642 -10.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7498 -9.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
5 10 1 0
3 11 1 0
12 13 1 0
13 14 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
15 18 1 0
12 15 1 0
12 22 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
23 31 1 0
26 31 2 0
14 25 1 0
13 9 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.42Molecular Weight (Monoisotopic): 420.1398AlogP: 3.82#Rotatable Bonds: 6Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.62CX Basic pKa: 5.63CX LogP: 3.35CX LogD: 3.34Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -1.36
References 1. Choi JY, Calvet CM, Gunatilleke SS, Ruiz C, Cameron MD, McKerrow JH, Podust LM, Roush WR.. (2013) Rational development of 4-aminopyridyl-based inhibitors targeting Trypanosoma cruzi CYP51 as anti-chagas agents., 56 (19): [PMID:24079662 ] [10.1021/jm401067s ]