The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1R,2S,6R,7S)-4-Aza-tricyclo[5.2.1.0(2,6)]dec-8-en-4-yl-N-quinolin-8-yl-benzamide ID: ALA2431798
PubChem CID: 73347820
Max Phase: Preclinical
Molecular Formula: C25H23N3O
Molecular Weight: 381.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc2cccnc12)c1ccc(N2C[C@@H]3[C@H](C2)[C@@H]2C=C[C@H]3C2)cc1
Standard InChI: InChI=1S/C25H23N3O/c29-25(27-23-5-1-3-16-4-2-12-26-24(16)23)17-8-10-20(11-9-17)28-14-21-18-6-7-19(13-18)22(21)15-28/h1-12,18-19,21-22H,13-15H2,(H,27,29)/t18-,19+,21-,22+
Standard InChI Key: YMZZEZMOHPNZKY-ZIEJVCCYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
29.7930 -9.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7919 -10.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4999 -10.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4982 -9.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2068 -9.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2075 -10.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9161 -10.6490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6243 -10.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6196 -9.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9105 -9.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5018 -11.4722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7951 -11.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7970 -12.6997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0864 -11.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0891 -10.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3813 -10.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6736 -10.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6781 -11.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3865 -11.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9644 -10.2565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8758 -9.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2189 -10.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6698 -9.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0756 -9.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6669 -8.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8508 -8.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4450 -9.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8553 -9.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6602 -8.4676 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.2687 -10.9037 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.4485 -9.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3509 -9.1261 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.1689 -9.4442 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
21 24 1 0
23 22 1 0
22 20 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
24 29 1 1
23 30 1 1
25 31 1 0
28 31 1 0
28 32 1 1
25 33 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 381.48Molecular Weight (Monoisotopic): 381.1841AlogP: 4.75#Rotatable Bonds: 3Polar Surface Area: 45.23Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.84CX LogP: 4.20CX LogD: 4.20Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.02
References 1. Narwal M, Koivunen J, Haikarainen T, Obaji E, Legala OE, Venkannagari H, Joensuu P, Pihlajaniemi T, Lehtiö L.. (2013) Discovery of tankyrase inhibiting flavones with increased potency and isoenzyme selectivity., 56 (20): [PMID:24116873 ] [10.1021/jm401463y ]