4-(1R,2S,6R,7S)-4-Aza-tricyclo[5.2.1.0(2,6)]dec-8-en-4-yl-N-quinolin-8-yl-benzamide

ID: ALA2431798

PubChem CID: 73347820

Max Phase: Preclinical

Molecular Formula: C25H23N3O

Molecular Weight: 381.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc2cccnc12)c1ccc(N2C[C@@H]3[C@H](C2)[C@@H]2C=C[C@H]3C2)cc1

Standard InChI:  InChI=1S/C25H23N3O/c29-25(27-23-5-1-3-16-4-2-12-26-24(16)23)17-8-10-20(11-9-17)28-14-21-18-6-7-19(13-18)22(21)15-28/h1-12,18-19,21-22H,13-15H2,(H,27,29)/t18-,19+,21-,22+

Standard InChI Key:  YMZZEZMOHPNZKY-ZIEJVCCYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   29.7930   -9.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7919  -10.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4999  -10.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4982   -9.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2068   -9.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2075  -10.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9161  -10.6490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6243  -10.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6196   -9.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9105   -9.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5018  -11.4722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7951  -11.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7970  -12.6997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0864  -11.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0891  -10.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3813  -10.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6736  -10.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6781  -11.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3865  -11.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9644  -10.2565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8758   -9.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2189  -10.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6698   -9.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0756   -9.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6669   -8.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8508   -8.5777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4450   -9.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8553   -9.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6602   -8.4676    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.2687  -10.9037    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.4485   -9.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3509   -9.1261    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.1689   -9.4442    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 24  1  0
 23 22  1  0
 22 20  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 24 29  1  1
 23 30  1  1
 25 31  1  0
 28 31  1  0
 28 32  1  1
 25 33  1  1
M  END

Associated Targets(Human)

TNKS2 Tchem Tankyrase 1/2 (384 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TNKS Tchem Tankyrase-1 (1241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 381.48Molecular Weight (Monoisotopic): 381.1841AlogP: 4.75#Rotatable Bonds: 3
Polar Surface Area: 45.23Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.84CX LogP: 4.20CX LogD: 4.20
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.02

References

1. Narwal M, Koivunen J, Haikarainen T, Obaji E, Legala OE, Venkannagari H, Joensuu P, Pihlajaniemi T, Lehtiö L..  (2013)  Discovery of tankyrase inhibiting flavones with increased potency and isoenzyme selectivity.,  56  (20): [PMID:24116873] [10.1021/jm401463y]

Source