The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-8-(2-(dimethylamino)ethoxy)-2,3-dimethoxyindeno[1,2-b]indol-10(5H)-one O-but-3-yn-2-yl oxime ID: ALA2436174
PubChem CID: 135532549
Max Phase: Preclinical
Molecular Formula: C25H27N3O4
Molecular Weight: 433.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#C[C@H](C)O/N=C1/c2cc(OC)c(OC)cc2-c2[nH]c3ccc(OCCN(C)C)cc3c21
Standard InChI: InChI=1S/C25H27N3O4/c1-7-15(2)32-27-25-18-14-22(30-6)21(29-5)13-17(18)24-23(25)19-12-16(8-9-20(19)26-24)31-11-10-28(3)4/h1,8-9,12-15,26H,10-11H2,2-6H3/b27-25-/t15-/m0/s1
Standard InChI Key: LSXXOBXVFRXXIU-PRVWPFRXSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
8.1076 -10.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1064 -11.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8212 -11.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8194 -10.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5348 -10.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5351 -11.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3251 -10.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8138 -10.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3250 -11.6287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8079 -12.2996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5988 -11.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5939 -12.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3036 -12.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0186 -12.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0197 -11.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3093 -10.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5798 -9.5053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7342 -10.8117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4489 -11.2244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1632 -10.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8778 -11.2245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5922 -10.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8778 -12.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3867 -9.3335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6414 -8.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4483 -8.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2552 -8.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0892 -7.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3930 -10.1382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3916 -11.7899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3928 -9.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6775 -11.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 9 1 0
8 7 1 0
7 5 1 0
8 9 2 0
9 10 1 0
10 12 1 0
11 8 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
7 17 2 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
17 24 1 0
24 25 1 0
25 26 1 0
26 27 3 0
25 28 1 1
1 29 1 0
2 30 1 0
29 31 1 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.51Molecular Weight (Monoisotopic): 433.2002AlogP: 3.90#Rotatable Bonds: 8Polar Surface Area: 68.31Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.38CX Basic pKa: 8.75CX LogP: 3.70CX LogD: 2.34Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -0.29
References 1. Rongved P, Kirsch G, Bouaziz Z, Jose J, Le Borgne M.. (2013) Indenoindoles and cyclopentacarbazoles as bioactive compounds: synthesis and biological applications., 69 [PMID:24090918 ] [10.1016/j.ejmech.2013.08.049 ]