(S)-8-(2-(dimethylamino)ethoxy)-2,3-dimethoxyindeno[1,2-b]indol-10(5H)-one O-but-3-yn-2-yl oxime

ID: ALA2436174

PubChem CID: 135532549

Max Phase: Preclinical

Molecular Formula: C25H27N3O4

Molecular Weight: 433.51

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C#C[C@H](C)O/N=C1/c2cc(OC)c(OC)cc2-c2[nH]c3ccc(OCCN(C)C)cc3c21

Standard InChI:  InChI=1S/C25H27N3O4/c1-7-15(2)32-27-25-18-14-22(30-6)21(29-5)13-17(18)24-23(25)19-12-16(8-9-20(19)26-24)31-11-10-28(3)4/h1,8-9,12-15,26H,10-11H2,2-6H3/b27-25-/t15-/m0/s1

Standard InChI Key:  LSXXOBXVFRXXIU-PRVWPFRXSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    8.1076  -10.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1064  -11.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8212  -11.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8194  -10.1378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5348  -10.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5351  -11.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3251  -10.2900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8138  -10.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3250  -11.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8079  -12.2996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5988  -11.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5939  -12.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3036  -12.4588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0186  -12.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0197  -11.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3093  -10.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5798   -9.5053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7342  -10.8117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4489  -11.2244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1632  -10.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8778  -11.2245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5922  -10.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8778  -12.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3867   -9.3335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6414   -8.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4483   -8.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2552   -8.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0892   -7.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3930  -10.1382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3916  -11.7899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3928   -9.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6775  -11.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  7  5  1  0
  8  9  2  0
  9 10  1  0
 10 12  1  0
 11  8  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 17  2  0
 15 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 17 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  3  0
 25 28  1  1
  1 29  1  0
  2 30  1  0
 29 31  1  0
 30 32  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2436174

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 433.51

Molecular Weight (Monoisotopic): 433.2002

AlogP: 3.90

#Rotatable Bonds: 8

Polar Surface Area: 68.31

Molecular Species: BASE

HBA: 6

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 13.38

CX Basic pKa: 8.75

CX LogP: 3.70

CX LogD: 2.34

Aromatic Rings: 3

Heavy Atoms: 32

QED Weighted: 0.34

Np Likeness Score: -0.29

References

1. Rongved P, Kirsch G, Bouaziz Z, Jose J, Le Borgne M..  (2013)  Indenoindoles and cyclopentacarbazoles as bioactive compounds: synthesis and biological applications.,  69  [PMID:24090918] [10.1016/j.ejmech.2013.08.049]

Source

Source(1):

• Scientific Literature