8-(2,6-difluorobenzoyl)-N-(4-methoxyphenyl)-2,8-diazaspiro[4.5]decane-2-carboxamide

ID: ALA2436560

PubChem CID: 72375939

Max Phase: Preclinical

Molecular Formula: C23H25F2N3O3

Molecular Weight: 429.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=O)N2CCC3(CCN(C(=O)c4c(F)cccc4F)CC3)C2)cc1

Standard InChI:  InChI=1S/C23H25F2N3O3/c1-31-17-7-5-16(6-8-17)26-22(30)28-14-11-23(15-28)9-12-27(13-10-23)21(29)20-18(24)3-2-4-19(20)25/h2-8H,9-15H2,1H3,(H,26,30)

Standard InChI Key:  SXXCEOGXMKLJOX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    7.2013   -6.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6089   -6.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4219   -6.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8315   -6.2222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4240   -5.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6068   -5.5079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4856   -5.9450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1933   -5.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9010   -5.9450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1933   -4.7192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9905   -6.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7898   -6.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6516   -5.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6487   -6.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0552   -6.9336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0594   -5.5182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8752   -5.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2858   -4.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8792   -4.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0578   -4.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6509   -4.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2795   -6.2355    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.8337   -4.8180    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.7779   -5.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7821   -4.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0753   -4.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3666   -4.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3692   -5.5414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0767   -5.9462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6583   -4.3123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6572   -3.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 12  1  1  0
  1 13  1  0
 13  9  1  0
  4 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 17 22  1  0
 21 23  1  0
  7 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 30 31  1  0
M  END

Associated Targets(Human)

Liver microsomes (16955 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EPHX2 Tchem Epoxide hydratase (3844 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Ephx2 Epoxide hydrolase 2 (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ephx2 Epoxide hydratase (467 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.47Molecular Weight (Monoisotopic): 429.1864AlogP: 4.13#Rotatable Bonds: 3
Polar Surface Area: 61.88Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.93CX LogD: 2.93
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.80Np Likeness Score: -1.39

References

1. Kato Y, Fuchi N, Saburi H, Nishimura Y, Watanabe A, Yagi M, Nakadera Y, Higashi E, Yamada M, Aoki T..  (2013)  Discovery of 2,8-diazaspiro[4.5]decane-based trisubstituted urea derivatives as highly potent soluble epoxide hydrolase inhibitors and orally active drug candidates for treating hypertension.,  23  (21): [PMID:24035338] [10.1016/j.bmcl.2013.08.054]

Source