The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(tetrahydro-2H-pyran-4-carbonyl)-N-(4-(trifluoromethoxy)phenyl)-2,8-diazaspiro[4.5]decane-2-carboxamide ID: ALA2436583
PubChem CID: 72374646
Max Phase: Preclinical
Molecular Formula: C22H28F3N3O4
Molecular Weight: 455.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(OC(F)(F)F)cc1)N1CCC2(CCN(C(=O)C3CCOCC3)CC2)C1
Standard InChI: InChI=1S/C22H28F3N3O4/c23-22(24,25)32-18-3-1-17(2-4-18)26-20(30)28-12-9-21(15-28)7-10-27(11-8-21)19(29)16-5-13-31-14-6-16/h1-4,16H,5-15H2,(H,26,30)
Standard InChI Key: QUQUGNOHPPAVRL-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.5341 -11.8985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0948 -9.0473 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6548 -11.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3652 -12.3329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2340 -11.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5301 -12.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5387 -13.3228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5287 -10.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1188 -11.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1023 -10.6928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2585 -13.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3116 -12.6087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1324 -12.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8152 -9.4584 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8200 -11.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6739 -12.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3901 -9.4603 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.8979 -13.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8173 -11.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9444 -12.3329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4556 -13.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6548 -11.0995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9001 -11.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2383 -11.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0792 -11.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1011 -9.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0812 -13.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3489 -11.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7505 -11.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3377 -10.4811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5187 -10.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1126 -11.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20 3 1 0
16 25 1 0
19 10 1 0
26 14 1 0
16 9 1 0
12 13 1 0
12 23 1 0
26 2 1 0
23 25 1 0
13 1 1 0
3 4 1 0
8 19 2 0
11 16 1 0
10 26 1 0
13 7 2 0
18 12 1 0
15 6 2 0
4 21 1 0
21 11 1 0
3 22 2 0
24 8 1 0
27 18 1 0
19 15 1 0
26 17 1 0
6 5 1 0
9 4 1 0
20 5 1 0
5 24 2 0
16 27 1 0
1 28 1 0
1 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.48Molecular Weight (Monoisotopic): 455.2032AlogP: 3.86#Rotatable Bonds: 3Polar Surface Area: 71.11Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.75CX Basic pKa: ┄CX LogP: 2.80CX LogD: 2.80Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.75Np Likeness Score: -1.28
References 1. Kato Y, Fuchi N, Saburi H, Nishimura Y, Watanabe A, Yagi M, Nakadera Y, Higashi E, Yamada M, Aoki T.. (2013) Discovery of 2,8-diazaspiro[4.5]decane-based trisubstituted urea derivatives as highly potent soluble epoxide hydrolase inhibitors and orally active drug candidates for treating hypertension., 23 (21): [PMID:24035338 ] [10.1016/j.bmcl.2013.08.054 ]