The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-(2-(methylsulfonamido)ethyl)piperidin-4-yl)methyl 5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenylcarbamate ID: ALA2440469
PubChem CID: 19962113
Max Phase: Preclinical
Molecular Formula: C19H26FN5O5S
Molecular Weight: 455.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(-c2ccc(F)cc2NC(=O)OCC2CCN(CCNS(C)(=O)=O)CC2)n1
Standard InChI: InChI=1S/C19H26FN5O5S/c1-13-22-18(30-24-13)16-4-3-15(20)11-17(16)23-19(26)29-12-14-5-8-25(9-6-14)10-7-21-31(2,27)28/h3-4,11,14,21H,5-10,12H2,1-2H3,(H,23,26)
Standard InChI Key: LBDRFTREBXLYOS-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
19.8791 -1.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4707 -1.1167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.0579 -1.8266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9069 -3.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9057 -4.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6206 -4.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3369 -4.4310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3341 -3.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6187 -3.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0471 -3.1853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0439 -2.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7568 -1.9451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3279 -1.9505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4729 -2.3549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1858 -1.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9021 -2.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6129 -1.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6140 -1.1181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8981 -0.7061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1812 -1.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3285 -0.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0430 -1.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7575 -0.7056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1864 -0.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0481 -4.8404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1356 -5.6608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9428 -5.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3542 -5.1158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8012 -4.5037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2796 -6.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1923 -3.1918 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 1 0
21 22 1 0
22 23 1 0
23 2 1 0
2 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 1 0
7 25 1 0
27 30 1 0
4 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.51Molecular Weight (Monoisotopic): 455.1639AlogP: 1.99#Rotatable Bonds: 8Polar Surface Area: 126.66Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.28CX Basic pKa: 7.76CX LogP: 1.61CX LogD: 1.10Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.62Np Likeness Score: -2.16
References 1. Brudeli B, Andressen KW, Moltzau LR, Nilsen NO, Levy FO, Klaveness J.. (2013) Acidic biphenyl derivatives: synthesis and biological activity of a new series of potent 5-HT(4) receptor antagonists., 21 (22): [PMID:24113240 ] [10.1016/j.bmc.2013.09.004 ]