The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-(3-Ethoxy-2-hydroxybenzylidene)-3-(2-(trifluoromethyl)pyridin-4-ylamino)benzohydrazide ID: ALA2440591
PubChem CID: 135968270
Max Phase: Preclinical
Molecular Formula: C22H19F3N4O3
Molecular Weight: 444.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cccc(/C=N/NC(=O)c2cccc(Nc3ccnc(C(F)(F)F)c3)c2)c1O
Standard InChI: InChI=1S/C22H19F3N4O3/c1-2-32-18-8-4-6-15(20(18)30)13-27-29-21(31)14-5-3-7-16(11-14)28-17-9-10-26-19(12-17)22(23,24)25/h3-13,30H,2H2,1H3,(H,26,28)(H,29,31)/b27-13+
Standard InChI Key: XRBWFXBPHGRTHK-UVHMKAGCSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
34.9125 -9.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9114 -10.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6262 -10.6073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3427 -10.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3398 -9.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6243 -8.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6260 -11.4324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1966 -10.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4824 -10.1933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7675 -10.6052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0534 -10.1922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3385 -10.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0540 -9.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6278 -10.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9136 -10.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9124 -11.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6316 -11.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3430 -11.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1996 -10.1879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4845 -10.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7738 -10.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0593 -10.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0578 -11.4217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7768 -11.8350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4884 -11.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7787 -12.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0651 -13.0741 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.4942 -13.0710 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.7720 -13.4839 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.0578 -10.6053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0591 -11.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7743 -11.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
2 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
15 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
24 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
4 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.41Molecular Weight (Monoisotopic): 444.1409AlogP: 4.71#Rotatable Bonds: 7Polar Surface Area: 95.84Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.24CX Basic pKa: 4.31CX LogP: 4.34CX LogD: 4.34Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.59
References 1. Congiu C, Onnis V.. (2013) Synthesis and biological evaluation of novel acylhydrazone derivatives as potential antitumor agents., 21 (21): [PMID:24071449 ] [10.1016/j.bmc.2013.08.026 ]