The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-(5-Chloro-2-hydroxybenzylidene)-2-(2-(trifluoromethyl)pyridin-4-ylamino)benzohydrazide ID: ALA2440592
PubChem CID: 135968273
Max Phase: Preclinical
Molecular Formula: C20H14ClF3N4O2
Molecular Weight: 434.81
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N/N=C/c1cc(Cl)ccc1O)c1ccccc1Nc1ccnc(C(F)(F)F)c1
Standard InChI: InChI=1S/C20H14ClF3N4O2/c21-13-5-6-17(29)12(9-13)11-26-28-19(30)15-3-1-2-4-16(15)27-14-7-8-25-18(10-14)20(22,23)24/h1-11,29H,(H,25,27)(H,28,30)/b26-11+
Standard InChI Key: UGTWNAOSQWGNEE-KBKYJPHKSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
21.3066 -11.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3055 -11.9271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0202 -12.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7367 -11.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7339 -11.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0184 -10.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0200 -13.1650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5907 -12.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8766 -11.9260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1617 -12.3380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4477 -11.9249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7328 -12.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4483 -11.0999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0222 -11.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3079 -12.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3068 -13.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0259 -13.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7373 -13.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0243 -11.0979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3109 -10.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3143 -9.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6018 -9.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8853 -9.8544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8858 -10.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5989 -11.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6042 -8.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3199 -8.2084 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.8910 -8.2041 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5997 -7.7915 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.0160 -9.8620 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
2 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
14 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
6 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.81Molecular Weight (Monoisotopic): 434.0757AlogP: 4.97#Rotatable Bonds: 5Polar Surface Area: 86.61Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.22CX Basic pKa: 4.27CX LogP: 6.05CX LogD: 5.99Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -1.74
References 1. Congiu C, Onnis V.. (2013) Synthesis and biological evaluation of novel acylhydrazone derivatives as potential antitumor agents., 21 (21): [PMID:24071449 ] [10.1016/j.bmc.2013.08.026 ]