The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
toluene-4-sulfonic acid 4-[2-(2-hydroxy-ethoxy)-ethoxy]-9,10-dioxo-9,10-dihydro-anthracen-1-yl ester ID: ALA2442834
PubChem CID: 72546228
Max Phase: Preclinical
Molecular Formula: C25H22O8S
Molecular Weight: 482.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)Oc2ccc(OCCOCCO)c3c2C(=O)c2ccccc2C3=O)cc1
Standard InChI: InChI=1S/C25H22O8S/c1-16-6-8-17(9-7-16)34(29,30)33-21-11-10-20(32-15-14-31-13-12-26)22-23(21)25(28)19-5-3-2-4-18(19)24(22)27/h2-11,26H,12-15H2,1H3
Standard InChI Key: KYLBPQMBXZPHIZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
4.9862 -11.1424 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.3925 -10.4257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5687 -10.4322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7059 -12.8117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7048 -13.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4186 -14.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4168 -12.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1312 -12.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1346 -13.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8529 -14.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8460 -12.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5689 -12.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -13.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2922 -14.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0103 -13.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0034 -12.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2824 -12.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8554 -14.8746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8415 -11.5629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2759 -11.5599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7029 -11.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7042 -12.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4201 -12.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1314 -12.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1222 -11.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4058 -11.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8486 -12.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2960 -14.8692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0114 -15.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7229 -14.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4384 -15.2712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1499 -14.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8653 -15.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5769 -14.8495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 2 0
11 19 2 0
17 20 1 0
20 1 1 0
1 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
14 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.51Molecular Weight (Monoisotopic): 482.1035AlogP: 2.93#Rotatable Bonds: 9Polar Surface Area: 116.20Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.75CX LogD: 3.75Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -0.29
References 1. Sangthong S, Ha H, Teerawattananon T, Ngamrojanavanich N, Neamati N, Muangsin N.. (2013) Overcoming doxorubicin-resistance in the NCI/ADR-RES model cancer cell line by novel anthracene-9,10-dione derivatives., 23 (22): [PMID:24095089 ] [10.1016/j.bmcl.2013.09.004 ]