The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-methoxybenzylamino)-9,10-dioxo-9,10-dihydroanthracen-1-yl 4-methylbenzenesulfonate ID: ALA2442835
PubChem CID: 72546227
Max Phase: Preclinical
Molecular Formula: C29H23NO6S
Molecular Weight: 513.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNc2ccc(OS(=O)(=O)c3ccc(C)cc3)c3c2C(=O)c2ccccc2C3=O)cc1
Standard InChI: InChI=1S/C29H23NO6S/c1-18-7-13-21(14-8-18)37(33,34)36-25-16-15-24(30-17-19-9-11-20(35-2)12-10-19)26-27(25)29(32)23-6-4-3-5-22(23)28(26)31/h3-16,30H,17H2,1-2H3
Standard InChI Key: VTZXTZLAVFOTEP-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
22.0059 -1.6933 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.4124 -0.9764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5883 -0.9828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7246 -3.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7235 -4.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4374 -4.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4357 -2.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1503 -3.3593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1537 -4.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8720 -4.6023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8653 -2.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5882 -3.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5912 -4.1852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3118 -4.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0301 -4.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0231 -3.3427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3019 -2.9349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8746 -5.4263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8607 -2.1139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2954 -2.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7228 -2.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7242 -2.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4402 -3.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1516 -2.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1424 -2.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4259 -1.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8690 -3.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3155 -5.4208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0311 -5.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0349 -6.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3226 -7.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3260 -7.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0422 -8.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7563 -7.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7493 -7.0560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0470 -9.1218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3358 -9.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 2 0
11 19 2 0
17 20 1 0
20 1 1 0
1 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
14 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.57Molecular Weight (Monoisotopic): 513.1246AlogP: 5.16#Rotatable Bonds: 7Polar Surface Area: 98.77Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.24CX LogP: 6.34CX LogD: 6.34Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -0.50
References 1. Sangthong S, Ha H, Teerawattananon T, Ngamrojanavanich N, Neamati N, Muangsin N.. (2013) Overcoming doxorubicin-resistance in the NCI/ADR-RES model cancer cell line by novel anthracene-9,10-dione derivatives., 23 (22): [PMID:24095089 ] [10.1016/j.bmcl.2013.09.004 ]