The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Isopropyl(4-(4-((Thiiran-2-ylmethyl)sulfonyl)phenoxy)phenyl)carbamate ID: ALA2442888
PubChem CID: 72711065
Max Phase: Preclinical
Molecular Formula: C19H21NO5S2
Molecular Weight: 407.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)Nc1ccc(Oc2ccc(S(=O)(=O)CC3CS3)cc2)cc1
Standard InChI: InChI=1S/C19H21NO5S2/c1-13(2)24-19(21)20-14-3-5-15(6-4-14)25-16-7-9-18(10-8-16)27(22,23)12-17-11-26-17/h3-10,13,17H,11-12H2,1-2H3,(H,20,21)
Standard InChI Key: FNTWGXGOCVTLKR-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
28.0682 -16.0967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6598 -15.3842 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.2470 -16.0941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6582 -14.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6570 -14.9948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3719 -15.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0883 -14.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0855 -14.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3701 -13.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7984 -13.7486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5145 -14.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5142 -14.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2294 -15.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9434 -14.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9376 -14.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2218 -13.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3724 -14.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0888 -15.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5001 -16.0876 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.9092 -15.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9422 -15.4068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2280 -14.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5132 -15.4057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2286 -14.1687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7990 -14.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0841 -15.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7996 -14.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 2 1 0
2 17 1 0
17 18 1 0
19 18 1 0
20 19 1 0
18 20 1 0
5 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
25 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.51Molecular Weight (Monoisotopic): 407.0861AlogP: 4.32#Rotatable Bonds: 7Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.23CX Basic pKa: ┄CX LogP: 3.38CX LogD: 3.38Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.69Np Likeness Score: -1.04
References 1. Gooyit M, Song W, Mahasenan KV, Lichtenwalter K, Suckow MA, Schroeder VA, Wolter WR, Mobashery S, Chang M.. (2013) O-phenyl carbamate and phenyl urea thiiranes as selective matrix metalloproteinase-2 inhibitors that cross the blood-brain barrier., 56 (20): [PMID:24028490 ] [10.1021/jm401217d ]