2-(R)-[(7-Chloro-1,1-dioxo-4H-1,2,4-benzothiadiazin-3-yl)amino]propyl triphenylphosphoniopropionate chloride

ID: ALA2443057

PubChem CID: 136233525

Max Phase: Preclinical

Molecular Formula: C31H30Cl2N3O4PS

Molecular Weight: 607.09

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](COC(=O)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC1=NS(=O)(=O)c2cc(Cl)ccc2N1.[Cl-]

Standard InChI:  InChI=1S/C31H30ClN3O4PS.ClH/c1-23(33-31-34-28-18-17-24(32)21-29(28)41(37,38)35-31)22-39-30(36)19-20-40(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27;/h2-18,21,23H,19-20,22H2,1H3,(H2,33,34,35);1H/q+1;/p-1/t23-;/m1./s1

Standard InChI Key:  AWALWPOHNSKNFO-GNAFDRTKSA-M

Molfile:  

     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
   24.7693   -4.1248    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   26.1602   -3.4819    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   19.7359   -4.7657    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.3248   -5.4810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1498   -5.4793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5891   -3.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5880   -4.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3028   -4.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3010   -3.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0163   -3.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0170   -4.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4473   -4.3483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4425   -3.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7267   -3.1112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1545   -3.1016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8714   -3.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5833   -3.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8764   -4.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3002   -3.5010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0121   -3.0841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7290   -3.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0071   -2.2592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8733   -4.7682    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   25.4410   -3.0754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1678   -4.3068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1525   -2.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9817   -3.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8681   -2.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8608   -1.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1394   -1.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4240   -1.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4348   -2.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3932   -4.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2138   -4.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6229   -3.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2052   -2.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3859   -2.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4581   -4.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4654   -5.5478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1841   -5.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8971   -5.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8863   -4.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  3  2  0
  3  5  2  0
  6  7  2  0
  7  8  1  0
  8 11  2  0
 10  9  2  0
  9  6  1  0
 10 11  1  0
 11  3  1  0
  3 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  1
 17 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
  7 23  1  0
 21 24  1  0
 24  2  1  0
  2 25  1  0
  2 26  1  0
  2 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
 27 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 27  1  0
 25 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 25  1  0
M  CHG  2   1  -1   2   1
M  END

Associated Targets(non-human)

H9c2 (3506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Kcnj11 Kir6.2/SUR1 (4 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 607.09Molecular Weight (Monoisotopic): 606.1378AlogP: 4.72#Rotatable Bonds: 9
Polar Surface Area: 96.86Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.09CX LogP: 5.74CX LogD: 5.74
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: -0.53

References

1. Constant-Urban C, Charif M, Goffin E, Van Heugen JC, Elmoualij B, Chiap P, Mouithys-Mickalad A, Serteyn D, Lebrun P, Pirotte B, De Tullio P..  (2013)  Triphenylphosphonium salts of 1,2,4-benzothiadiazine 1,1-dioxides related to diazoxide targeting mitochondrial ATP-sensitive potassium channels.,  23  (21): [PMID:24055044] [10.1016/j.bmcl.2013.08.091]

Source