The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(R)-[(7-Chloro-1,1-dioxo-4H-1,2,4-benzothiadiazin-3-yl)amino]propyl triphenylphosphoniobutyrate chloride ID: ALA2443058
PubChem CID: 136233527
Max Phase: Preclinical
Molecular Formula: C32H32Cl2N3O4PS
Molecular Weight: 621.12
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](COC(=O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC1=NS(=O)(=O)c2cc(Cl)ccc2N1.[Cl-]
Standard InChI: InChI=1S/C32H32ClN3O4PS.ClH/c1-24(34-32-35-29-20-19-25(33)22-30(29)42(38,39)36-32)23-40-31(37)18-11-21-41(26-12-5-2-6-13-26,27-14-7-3-8-15-27)28-16-9-4-10-17-28;/h2-10,12-17,19-20,22,24H,11,18,21,23H2,1H3,(H2,34,35,36);1H/q+1;/p-1/t24-;/m1./s1
Standard InChI Key: RENOZWNFPDHYIX-GJFSDDNBSA-M
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
10.0917 -13.2084 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.8996 -13.3245 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.4886 -14.0398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3136 -14.0381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7528 -12.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7516 -12.9149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4664 -13.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4646 -11.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1800 -12.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1808 -12.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6111 -12.9069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6063 -12.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8904 -11.6697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3182 -11.6601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0352 -12.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7472 -11.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0403 -12.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4642 -12.0596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1761 -11.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8931 -12.0508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1711 -10.8178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0368 -13.3268 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.6050 -11.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3220 -12.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0340 -11.6253 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
12.0292 -10.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8584 -11.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0292 -12.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7439 -10.3852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7396 -9.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0219 -9.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3072 -9.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3152 -10.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2690 -12.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0927 -12.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5055 -11.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0886 -10.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2662 -10.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3103 -12.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3053 -13.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0176 -14.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7366 -13.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7382 -12.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
2 4 2 0
5 6 2 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 2 1 0
2 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
12 14 1 0
14 15 1 0
15 16 1 0
15 17 1 1
16 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
6 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
26 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 26 1 0
27 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 27 1 0
28 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 28 1 0
M CHG 2 1 -1 25 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 621.12Molecular Weight (Monoisotopic): 620.1534AlogP: 5.11#Rotatable Bonds: 10Polar Surface Area: 96.86Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.24CX LogP: 6.02CX LogD: 6.02Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: -0.46
References 1. Constant-Urban C, Charif M, Goffin E, Van Heugen JC, Elmoualij B, Chiap P, Mouithys-Mickalad A, Serteyn D, Lebrun P, Pirotte B, De Tullio P.. (2013) Triphenylphosphonium salts of 1,2,4-benzothiadiazine 1,1-dioxides related to diazoxide targeting mitochondrial ATP-sensitive potassium channels., 23 (21): [PMID:24055044 ] [10.1016/j.bmcl.2013.08.091 ]