2-(R)-[(7-Chloro-1,1-dioxo-4H-1,2,4-benzothiadiazin-3-yl)amino]propyl triphenylphosphoniobutyrate chloride

ID: ALA2443058

PubChem CID: 136233527

Max Phase: Preclinical

Molecular Formula: C32H32Cl2N3O4PS

Molecular Weight: 621.12

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](COC(=O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC1=NS(=O)(=O)c2cc(Cl)ccc2N1.[Cl-]

Standard InChI:  InChI=1S/C32H32ClN3O4PS.ClH/c1-24(34-32-35-29-20-19-25(33)22-30(29)42(38,39)36-32)23-40-31(37)18-11-21-41(26-12-5-2-6-13-26,27-14-7-3-8-15-27)28-16-9-4-10-17-28;/h2-10,12-17,19-20,22,24H,11,18,21,23H2,1H3,(H2,34,35,36);1H/q+1;/p-1/t24-;/m1./s1

Standard InChI Key:  RENOZWNFPDHYIX-GJFSDDNBSA-M

Molfile:  

     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
   10.0917  -13.2084    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.8996  -13.3245    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4886  -14.0398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3136  -14.0381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7528  -12.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7516  -12.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4664  -13.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4646  -11.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1800  -12.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1808  -12.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6111  -12.9069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6063  -12.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8904  -11.6697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3182  -11.6601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0352  -12.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7472  -11.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0403  -12.8932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4642  -12.0596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1761  -11.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8931  -12.0508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1711  -10.8178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0368  -13.3268    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.6050  -11.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3220  -12.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0340  -11.6253    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   12.0292  -10.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8584  -11.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0292  -12.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7439  -10.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7396   -9.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0219   -9.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3072   -9.5726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3152  -10.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2690  -12.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0927  -12.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5055  -11.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0886  -10.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2662  -10.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3103  -12.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3053  -13.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0176  -14.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7366  -13.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7382  -12.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  2  4  2  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
 10  2  1  0
  2 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  1
 16 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
  6 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
 26 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 26  1  0
 27 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 27  1  0
 28 39  2  0
 39 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  2  0
 43 28  1  0
M  CHG  2   1  -1  25   1
M  END

Associated Targets(non-human)

H9c2 (3506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Kcnj11 Kir6.2/SUR1 (4 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 621.12Molecular Weight (Monoisotopic): 620.1534AlogP: 5.11#Rotatable Bonds: 10
Polar Surface Area: 96.86Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.24CX LogP: 6.02CX LogD: 6.02
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: -0.46

References

1. Constant-Urban C, Charif M, Goffin E, Van Heugen JC, Elmoualij B, Chiap P, Mouithys-Mickalad A, Serteyn D, Lebrun P, Pirotte B, De Tullio P..  (2013)  Triphenylphosphonium salts of 1,2,4-benzothiadiazine 1,1-dioxides related to diazoxide targeting mitochondrial ATP-sensitive potassium channels.,  23  (21): [PMID:24055044] [10.1016/j.bmcl.2013.08.091]

Source