The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(R)-[(7-Chloro-1,1-dioxo-4H-1,2,4-benzothiadiazin-3-yl)amino]propyl triphenylphosphonioacetate chloride ID: ALA2443059
PubChem CID: 136219392
Max Phase: Preclinical
Molecular Formula: C30H28Cl2N3O4PS
Molecular Weight: 593.07
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](COC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC1=NS(=O)(=O)c2cc(Cl)ccc2N1.[Cl-]
Standard InChI: InChI=1S/C30H28ClN3O4PS.ClH/c1-22(32-30-33-27-18-17-23(31)19-28(27)40(36,37)34-30)20-38-29(35)21-39(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26;/h2-19,22H,20-21H2,1H3,(H2,32,33,34);1H/q+1;/p-1/t22-;/m1./s1
Standard InChI Key: CUNINQXZVDUHDH-VZYDHVRKSA-M
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
9.3084 -5.1834 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.9968 -3.7506 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
11.8217 -3.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2913 -5.4410 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.8802 -6.1564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7052 -6.1547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1444 -4.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1433 -5.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8580 -5.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8563 -3.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5717 -4.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5724 -5.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0028 -5.0236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9980 -4.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2821 -3.7864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7100 -3.7768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4269 -4.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1389 -3.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4320 -5.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8559 -4.1762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5678 -3.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2848 -4.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5628 -2.9344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4285 -5.4435 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.9917 -2.9257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7055 -2.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7007 -1.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9832 -1.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2690 -1.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2771 -2.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2340 -4.4569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0583 -4.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4673 -3.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0460 -3.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2231 -3.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9917 -4.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2730 -4.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2676 -5.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9796 -6.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6985 -5.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7002 -4.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
5 4 2 0
4 6 2 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
12 4 1 0
4 13 1 0
13 14 2 0
14 15 1 0
15 11 1 0
14 16 1 0
16 17 1 0
17 18 1 0
17 19 1 1
18 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
8 24 1 0
22 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
3 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 3 1 0
2 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
M CHG 2 1 -1 2 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 593.07Molecular Weight (Monoisotopic): 592.1221AlogP: 4.33#Rotatable Bonds: 8Polar Surface Area: 96.86Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.02CX LogP: 5.29CX LogD: 5.29Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: -0.58
References 1. Constant-Urban C, Charif M, Goffin E, Van Heugen JC, Elmoualij B, Chiap P, Mouithys-Mickalad A, Serteyn D, Lebrun P, Pirotte B, De Tullio P.. (2013) Triphenylphosphonium salts of 1,2,4-benzothiadiazine 1,1-dioxides related to diazoxide targeting mitochondrial ATP-sensitive potassium channels., 23 (21): [PMID:24055044 ] [10.1016/j.bmcl.2013.08.091 ]