The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{[(5-Benzyl-4-methyl-6-oxo-1,6-dihydropyrimidin-2-yl)sulfanyl]acetyl}-2-chlorobenzenesulfonamide ID: ALA2443196
PubChem CID: 136259430
Max Phase: Preclinical
Molecular Formula: C20H18ClN3O4S2
Molecular Weight: 463.97
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(SCC(=O)c2ccc(S(N)(=O)=O)c(Cl)c2)[nH]c(=O)c1Cc1ccccc1
Standard InChI: InChI=1S/C20H18ClN3O4S2/c1-12-15(9-13-5-3-2-4-6-13)19(26)24-20(23-12)29-11-17(25)14-7-8-18(16(21)10-14)30(22,27)28/h2-8,10H,9,11H2,1H3,(H2,22,27,28)(H,23,24,26)
Standard InChI Key: CWKSXTMMSXHYOD-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
11.4154 -8.5554 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.0023 -9.2696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8272 -9.2703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1313 -7.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1301 -8.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8449 -8.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5613 -8.1431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5584 -7.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8431 -6.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2714 -6.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9873 -7.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2682 -6.0725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7002 -6.8921 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.4162 -7.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4162 -8.1257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1313 -8.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8452 -8.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8394 -7.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1237 -6.8850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7012 -8.1425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8447 -9.3814 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.5507 -6.8733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5617 -8.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1340 -9.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2741 -8.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9894 -8.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7013 -8.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6975 -7.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9760 -6.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2671 -7.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 14 1 0
5 1 1 0
1 20 1 0
6 21 1 0
18 22 2 0
17 23 1 0
16 24 1 0
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.97Molecular Weight (Monoisotopic): 463.0427AlogP: 2.94#Rotatable Bonds: 7Polar Surface Area: 122.98Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.75CX Basic pKa: ┄CX LogP: 3.17CX LogD: 3.03Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: -1.88
References 1. Čapkauskaitė E, Zubrienė A, Smirnov A, Torresan J, Kišonaitė M, Kazokaitė J, Gylytė J, Michailovienė V, Jogaitė V, Manakova E, Gražulis S, Tumkevičius S, Matulis D.. (2013) Benzenesulfonamides with pyrimidine moiety as inhibitors of human carbonic anhydrases I, II, VI, VII, XII, and XIII., 21 (22): [PMID:24103428 ] [10.1016/j.bmc.2013.09.029 ]