The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-oxo-1'-[2-(2-pyridyl)ethyl]spiro[3,4-dihydro-2H-chromene-2,4'-(hexahydropyridine)]-7-yl]methanesulfonamide hydrochloride hydrate ID: ALA2447957
PubChem CID: 73346592
Max Phase: Preclinical
Molecular Formula: C21H28ClN3O5S
Molecular Weight: 415.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)Nc1ccc2c(c1)OC1(CCN(CCc3ccccn3)CC1)CC2=O.Cl.O
Standard InChI: InChI=1S/C21H25N3O4S.ClH.H2O/c1-29(26,27)23-17-5-6-18-19(25)15-21(28-20(18)14-17)8-12-24(13-9-21)11-7-16-4-2-3-10-22-16;;/h2-6,10,14,23H,7-9,11-13,15H2,1H3;1H;1H2
Standard InChI Key: IDDZXMWXOUVEHR-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
2.7054 -2.4643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8000 0.3500 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0542 0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0542 1.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7750 1.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7667 -0.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4917 0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4917 1.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0875 -0.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3417 -0.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9167 -0.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3417 1.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3875 1.0708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2083 -0.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3708 0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7750 2.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0500 -1.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4875 -0.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2042 0.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3417 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6292 -0.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9167 0.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2000 -0.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0542 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3708 1.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5208 0.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7542 -2.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7667 -0.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4792 -1.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4792 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5357 -1.8482 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 10 2 0
4 12 2 0
5 4 1 0
6 3 1 0
7 6 1 0
8 5 1 0
9 2 1 0
10 15 1 0
11 22 1 0
12 25 1 0
13 2 2 0
14 2 2 0
15 9 1 0
16 5 2 0
17 24 2 0
18 7 1 0
19 7 1 0
20 21 1 0
21 11 1 0
22 19 1 0
23 18 1 0
24 20 1 0
25 15 2 0
26 2 1 0
27 17 1 0
28 24 1 0
29 30 1 0
30 28 2 0
3 4 1 0
7 8 1 0
23 11 1 0
27 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.52Molecular Weight (Monoisotopic): 415.1566AlogP: 2.50#Rotatable Bonds: 5Polar Surface Area: 88.60Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.43CX Basic pKa: 7.57CX LogP: 0.17CX LogD: -0.01Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.81Np Likeness Score: -1.33
References 1. Elliott JM, Selnick HG, Claremon DA, Baldwin JJ, Buhrow SA, Butcher JW, Habecker CN, King SW, Lynch JJ, Phillips BT.. (1992) 4-Oxospiro[benzopyran-2,4'-piperidines] as class III antiarrhythmic agents. Pharmacological studies on 3,4-dihydro-1'-[2-(benzofurazan-5-yl)- ethyl]-6-methanesulfonamidospiro[(2H)-1-benzopyran-2,4'-piperidin]-4-on e (L-691,121)., 35 (21): [PMID:1433205 ] [10.1021/jm00099a028 ]