The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[1-(Carboxymethyl-indan-2-yl-carbamoyl)-5-(4-chloro-3-sulfamoyl-benzoylamino)-pentylamino]-4-phenyl-butyric acid hydrochloride ID: ALA2448082
PubChem CID: 73351181
Max Phase: Preclinical
Molecular Formula: C34H40Cl2N4O8S
Molecular Weight: 699.23
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.NS(=O)(=O)c1cc(C(=O)NCCCC[C@H](N[C@@H](CCc2ccccc2)C(=O)O)C(=O)N(CC(=O)O)C2Cc3ccccc3C2)ccc1Cl
Standard InChI: InChI=1S/C34H39ClN4O8S.ClH/c35-27-15-14-25(20-30(27)48(36,46)47)32(42)37-17-7-6-12-28(38-29(34(44)45)16-13-22-8-2-1-3-9-22)33(43)39(21-31(40)41)26-18-23-10-4-5-11-24(23)19-26;/h1-5,8-11,14-15,20,26,28-29,38H,6-7,12-13,16-19,21H2,(H,37,42)(H,40,41)(H,44,45)(H2,36,46,47);1H/t28-,29-;/m0./s1
Standard InChI Key: BXEUTDLUDQQXLK-OCPPCWRMSA-N
Molfile:
RDKit 2D
49 51 0 0 0 0 0 0 0 0999 V2000
7.4196 -5.3304 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 -6.2917 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.0375 -5.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2042 0.1958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4875 0.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2042 -0.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0375 -5.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0542 0.6083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7750 0.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3417 -0.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8750 -1.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -1.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3417 0.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8042 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6250 -1.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -6.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 0.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6042 -5.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 -7.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6292 0.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4875 1.4333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6042 -6.7167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0375 -3.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0625 -1.0500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 -5.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3417 0.6125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 -5.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6292 0.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 -3.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6292 -1.0500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -7.1250 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.6292 -0.6292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9167 0.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1917 0.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7750 -0.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0292 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3917 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1917 1.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4792 0.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -2.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8000 -3.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6250 -3.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4792 1.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7667 0.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7667 1.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 5 1 0
5 9 1 0
6 4 1 0
7 3 1 0
8 9 1 0
9 37 1 6
10 11 1 0
11 7 2 0
15 12 1 6
13 6 1 0
14 6 1 0
15 8 1 0
16 14 1 0
17 13 1 0
18 3 2 0
19 4 1 0
20 2 2 0
21 2 2 0
22 19 1 0
23 5 2 0
24 2 1 0
25 10 2 0
26 12 2 0
27 29 2 0
28 22 2 0
29 18 1 0
30 15 1 0
31 10 1 0
32 12 1 0
33 18 1 0
34 22 1 0
35 30 1 0
36 35 1 0
37 43 1 0
38 17 1 0
39 16 1 0
40 31 1 0
41 36 1 0
42 36 2 0
43 44 1 0
44 40 1 0
45 39 2 0
46 38 2 0
47 41 2 0
48 42 1 0
49 48 2 0
27 11 1 0
17 16 2 0
45 46 1 0
47 49 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 699.23Molecular Weight (Monoisotopic): 698.2177AlogP: 3.01#Rotatable Bonds: 17Polar Surface Area: 196.20Molecular Species: ZWITTERIONHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.77CX Basic pKa: 9.58CX LogP: 1.25CX LogD: -1.67Aromatic Rings: 3Heavy Atoms: 48QED Weighted: 0.13Np Likeness Score: -0.74
References 1. Barton JN, Piwinski JJ, Skiles JW, Regan JR, Menard PR, Desai R, Golec FS, Reilly LW, Goetzen T, Ueng SN.. (1990) Angiotensin-converting enzyme inhibitors. 9. Novel [[N-(1-carboxy-3-phenylpropyl)amino]acyl]glycine derivatives with diuretic activity., 33 (6): [PMID:2342054 ] [10.1021/jm00168a012 ]