2-[1-(Carboxymethyl-indan-2-yl-carbamoyl)-5-(4-chloro-3-sulfamoyl-benzoylamino)-pentylamino]-4-phenyl-butyric acid ethyl ester hydrochloride

ID: ALA2448083

PubChem CID: 73355699

Max Phase: Preclinical

Molecular Formula: C36H44Cl2N4O8S

Molecular Weight: 727.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](CCCCNC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)C(=O)N(CC(=O)O)C1Cc2ccccc2C1.Cl

Standard InChI:  InChI=1S/C36H43ClN4O8S.ClH/c1-2-49-36(46)31(18-15-24-10-4-3-5-11-24)40-30(35(45)41(23-33(42)43)28-20-25-12-6-7-13-26(25)21-28)14-8-9-19-39-34(44)27-16-17-29(37)32(22-27)50(38,47)48;/h3-7,10-13,16-17,22,28,30-31,40H,2,8-9,14-15,18-21,23H2,1H3,(H,39,44)(H,42,43)(H2,38,47,48);1H/t30-,31-;/m0./s1

Standard InChI Key:  ATIBNGRTVCHCKC-PNXDLZEOSA-N

Molfile:  

     RDKit          2D

 51 53  0  0  0  0  0  0  0  0999 V2000
    7.2857   -4.5804    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.3167   -6.2917    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0375   -5.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2042    0.1958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4875    0.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2042   -0.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0375   -5.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0542    0.6083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7750    0.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542   -4.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417   -0.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8750   -1.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4917   -1.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417    0.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8042   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6250   -1.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542   -6.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9167    0.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6042   -5.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3167   -7.1167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6292    0.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4875    1.4333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6042   -6.7167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0375   -3.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0625   -1.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4667   -5.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3417    0.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4667   -5.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6292    0.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4667   -3.4042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542   -7.1250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.6292   -1.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6292   -0.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167    0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917    0.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7750   -0.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0292   -2.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3917   -2.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4667   -2.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6292   -1.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4792    0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917    1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1792   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1792   -2.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167   -2.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6250   -3.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8000   -3.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4792    1.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7667    0.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7667    1.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  5  1  0
  5  9  1  0
  6  4  1  0
  7  3  1  0
  8  9  1  0
  9 37  1  6
 10 11  1  0
 11  7  2  0
 15 12  1  6
 13  6  1  0
 14  6  1  0
 15  8  1  0
 16 14  1  0
 17 13  1  0
 18  3  2  0
 19  4  1  0
 20  2  2  0
 21  2  2  0
 22 19  1  0
 23  5  2  0
 24  2  1  0
 25 10  2  0
 26 12  2  0
 27 29  2  0
 28 22  2  0
 29 18  1  0
 30 15  1  0
 31 10  1  0
 32 18  1  0
 33 12  1  0
 34 22  1  0
 35 30  1  0
 36 35  1  0
 37 44  1  0
 38 17  1  0
 39 16  1  0
 40 31  1  0
 41 33  1  0
 42 36  2  0
 43 36  1  0
 44 45  1  0
 45 40  1  0
 46 41  1  0
 47 38  2  0
 48 39  2  0
 49 43  2  0
 50 42  1  0
 51 49  1  0
 27 11  1  0
 17 16  2  0
 48 47  1  0
 51 50  2  0
M  END

Associated Targets(non-human)

Ace Angiotensin-converting enzyme (1080 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 727.28Molecular Weight (Monoisotopic): 726.2490AlogP: 3.49#Rotatable Bonds: 18
Polar Surface Area: 185.20Molecular Species: ACIDHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.88CX Basic pKa: 5.40CX LogP: 2.61CX LogD: 1.16
Aromatic Rings: 3Heavy Atoms: 50QED Weighted: 0.11Np Likeness Score: -0.80

References

1. Barton JN, Piwinski JJ, Skiles JW, Regan JR, Menard PR, Desai R, Golec FS, Reilly LW, Goetzen T, Ueng SN..  (1990)  Angiotensin-converting enzyme inhibitors. 9. Novel [[N-(1-carboxy-3-phenylpropyl)amino]acyl]glycine derivatives with diuretic activity.,  33  (6): [PMID:2342054] [10.1021/jm00168a012]

Source