4-(5-{Benzyl-[2-(1-ethoxycarbonyl-3-phenyl-propylamino)-propionyl]-amino}-5-carboxy-pentylamino)-2-chloro-5-sulfamoyl-benzoic acid ethyl ester hydrochloride

ID: ALA2448090

PubChem CID: 73349645

Max Phase: Preclinical

Molecular Formula: C37H48Cl2N4O9S

Molecular Weight: 759.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1cc(S(N)(=O)=O)c(NCCCC[C@H](C(=O)O)N(Cc2ccccc2)C(=O)[C@H](C)N[C@@H](CCc2ccccc2)C(=O)OCC)cc1Cl.Cl

Standard InChI:  InChI=1S/C37H47ClN4O9S.ClH/c1-4-50-36(46)28-22-33(52(39,48)49)31(23-29(28)38)40-21-13-12-18-32(35(44)45)42(24-27-16-10-7-11-17-27)34(43)25(3)41-30(37(47)51-5-2)20-19-26-14-8-6-9-15-26;/h6-11,14-17,22-23,25,30,32,40-41H,4-5,12-13,18-21,24H2,1-3H3,(H,44,45)(H2,39,48,49);1H/t25-,30-,32+;/m0./s1

Standard InChI Key:  YJMQXMABEIUURC-LQCAPSNESA-N

Molfile:  

     RDKit          2D

 53 54  0  0  0  0  0  0  0  0999 V2000
    8.7857   -4.0714    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.6125   -0.8667    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.3292   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0542   -3.7542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7542   -1.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3375   -3.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0417   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3375   -2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7625   -2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4750   -0.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -3.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0417   -2.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9042   -3.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6250   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4792   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1917   -4.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1917   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9000   -1.2875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6042   -0.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0542   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3375   -2.5167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8917   -0.4542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4750   -0.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8667   -3.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125   -5.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792   -3.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6250   -2.5125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4750   -2.5125    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -4.1667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1917   -1.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792   -5.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -4.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2333   -3.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9500   -3.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6250   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9042   -2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9042   -0.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792   -5.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4792   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -5.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9500   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6708   -3.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4792   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -2.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2333   -6.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6167   -1.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -4.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3833   -3.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6708   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4792   -6.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3833   -2.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -5.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4 11  1  0
  5  7  1  0
  6  4  1  0
  7  3  2  0
  8  3  1  0
  9 12  1  0
 10  5  1  0
 11 35  1  6
 12  8  2  0
 13 14  1  0
 14  6  1  0
 15 11  1  0
 17 16  1  6
 17 13  1  0
 18  2  2  0
 19  2  2  0
 20  4  1  0
 21  6  2  0
 22  2  1  0
 23 10  2  0
 24 15  2  0
 25 16  2  0
 26 17  1  0
 27  8  1  0
 28  9  1  0
 29 15  1  0
 30 10  1  0
 31 16  1  0
 32 20  1  0
 33 26  1  0
 34 33  1  0
 35 44  1  0
 14 36  1  6
 37 27  1  0
 38 30  1  0
 39 31  1  0
 40 32  1  0
 41 32  2  0
 42 34  1  0
 43 34  2  0
 44 45  1  0
 45 37  1  0
 46 39  1  0
 47 38  1  0
 48 40  2  0
 49 43  1  0
 50 42  2  0
 51 41  1  0
 52 49  2  0
 53 51  2  0
  9  5  2  0
 53 48  1  0
 50 52  1  0
M  END

Associated Targets(non-human)

Ace Angiotensin-converting enzyme (1080 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 759.32Molecular Weight (Monoisotopic): 758.2752AlogP: 4.77#Rotatable Bonds: 21
Polar Surface Area: 194.43Molecular Species: ACIDHBA: 10HBD: 4
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.40CX Basic pKa: 5.19CX LogP: 3.60CX LogD: 2.04
Aromatic Rings: 3Heavy Atoms: 52QED Weighted: 0.09Np Likeness Score: -0.78

References

1. Barton JN, Piwinski JJ, Skiles JW, Regan JR, Menard PR, Desai R, Golec FS, Reilly LW, Goetzen T, Ueng SN..  (1990)  Angiotensin-converting enzyme inhibitors. 9. Novel [[N-(1-carboxy-3-phenylpropyl)amino]acyl]glycine derivatives with diuretic activity.,  33  (6): [PMID:2342054] [10.1021/jm00168a012]

Source