The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-{Benzyl-[2-(1-carboxy-3-phenyl-propylamino)-propionyl]-amino}-5-carboxy-pentylamino)-2-chloro-5-sulfamoyl-benzoic acid hydrochloride ID: ALA2448091
PubChem CID: 73348095
Max Phase: Preclinical
Molecular Formula: C33H40Cl2N4O9S
Molecular Weight: 703.21
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N(Cc1ccccc1)[C@H](CCCCNc1cc(Cl)c(C(=O)O)cc1S(N)(=O)=O)C(=O)O.Cl
Standard InChI: InChI=1S/C33H39ClN4O9S.ClH/c1-21(37-26(32(42)43)16-15-22-10-4-2-5-11-22)30(39)38(20-23-12-6-3-7-13-23)28(33(44)45)14-8-9-17-36-27-19-25(34)24(31(40)41)18-29(27)48(35,46)47;/h2-7,10-13,18-19,21,26,28,36-37H,8-9,14-17,20H2,1H3,(H,40,41)(H,42,43)(H,44,45)(H2,35,46,47);1H/t21-,26-,28+;/m0./s1
Standard InChI Key: OUOVFYYRLOLDCD-YRXFTSSVSA-N
Molfile:
RDKit 2D
49 50 0 0 0 0 0 0 0 0999 V2000
3.2411 -6.2411 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.9790 -0.8810 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6972 -1.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4133 -3.7703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1251 -1.2819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6951 -3.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4112 -0.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7055 -2.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1335 -2.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8474 -0.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1273 -3.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4112 -2.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2589 -3.3569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9812 -3.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8413 -3.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5449 -4.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5449 -3.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2650 -1.2944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9707 -0.0543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4133 -4.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6951 -2.5302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2567 -0.4635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8474 -0.0293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2296 -3.0688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2589 -5.0146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8309 -3.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9915 -2.5219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8474 -2.5219 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.5656 -1.2776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5553 -4.1837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8309 -5.0146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1273 -5.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1169 -3.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6012 -3.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1273 -2.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9812 -4.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2692 -2.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1273 -5.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8413 -4.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6012 -2.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3235 -3.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8413 -2.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5553 -2.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3235 -2.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0375 -3.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8413 -6.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5553 -5.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5553 -5.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0375 -2.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 11 1 0
5 7 1 0
6 4 1 0
7 3 2 0
8 3 1 0
9 12 1 0
10 5 1 0
11 35 1 6
12 8 2 0
13 14 1 0
14 6 1 0
15 11 1 0
17 16 1 6
17 13 1 0
18 2 2 0
19 2 2 0
20 4 1 0
21 6 2 0
22 2 1 0
23 10 2 0
24 15 2 0
25 16 2 0
26 17 1 0
27 8 1 0
28 9 1 0
29 10 1 0
30 15 1 0
31 16 1 0
32 20 1 0
33 26 1 0
34 33 1 0
35 42 1 0
14 36 1 6
37 27 1 0
38 32 2 0
39 32 1 0
40 34 1 0
41 34 2 0
42 43 1 0
43 37 1 0
44 40 2 0
45 41 1 0
46 38 1 0
47 39 2 0
48 47 1 0
49 45 2 0
9 5 2 0
46 48 2 0
44 49 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 703.21Molecular Weight (Monoisotopic): 702.2126AlogP: 3.81#Rotatable Bonds: 19Polar Surface Area: 216.43Molecular Species: ZWITTERIONHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.71CX Basic pKa: 9.20CX LogP: 1.47CX LogD: -4.99Aromatic Rings: 3Heavy Atoms: 48QED Weighted: 0.10Np Likeness Score: -0.73
References 1. Barton JN, Piwinski JJ, Skiles JW, Regan JR, Menard PR, Desai R, Golec FS, Reilly LW, Goetzen T, Ueng SN.. (1990) Angiotensin-converting enzyme inhibitors. 9. Novel [[N-(1-carboxy-3-phenylpropyl)amino]acyl]glycine derivatives with diuretic activity., 33 (6): [PMID:2342054 ] [10.1021/jm00168a012 ]