The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID26514325 ID: ALA2448605
PubChem CID: 69740920
Max Phase: Preclinical
Molecular Formula: C21H20N4O7
Molecular Weight: 440.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(=O)n(Cc2ccc([N+](=O)[O-])cc2)c(=O)n([C@@H](Cc2ccccc2)C(=O)O)c1=O
Standard InChI: InChI=1S/C21H20N4O7/c1-2-22-19(28)23(13-15-8-10-16(11-9-15)25(31)32)21(30)24(20(22)29)17(18(26)27)12-14-6-4-3-5-7-14/h3-11,17H,2,12-13H2,1H3,(H,26,27)/t17-/m0/s1
Standard InChI Key: CCLINJGMVNJMNW-KRWDZBQOSA-N
Molfile:
RDKit 2D
32 34 0 0 1 0 0 0 0 0999 V2000
0.8763 1.0551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9816 1.0551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5527 -1.4199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 3.1176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8763 1.8801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 -4.3074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5908 -4.3074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5527 1.0551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 -0.1824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2671 -0.1824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8763 -3.8949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 0.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2671 0.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5527 -0.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5527 1.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8763 -0.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 2.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2671 2.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9816 -0.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8763 -1.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2671 3.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5908 -1.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 -1.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8763 -3.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5908 -2.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 -2.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9816 -1.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9816 3.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5527 3.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9816 4.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5527 4.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2671 4.7676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 12 2 0
2 13 2 0
3 14 2 0
4 17 2 0
5 17 1 0
6 11 2 0
7 11 1 0
8 12 1 0
8 13 1 0
8 15 1 0
9 12 1 0
9 14 1 0
9 16 1 0
10 13 1 0
10 14 1 0
10 19 1 0
11 24 1 0
15 17 1 0
15 18 1 1
16 20 1 0
18 21 1 0
19 27 1 0
20 22 2 0
20 23 1 0
21 28 2 0
21 29 1 0
22 25 1 0
23 26 2 0
24 25 2 0
24 26 1 0
28 30 1 0
29 31 2 0
30 32 2 0
31 32 1 0
M CHG 2 7 -1 11 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.41Molecular Weight (Monoisotopic): 440.1332AlogP: 1.02#Rotatable Bonds: 8Polar Surface Area: 146.44Molecular Species: ACIDHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.44CX Basic pKa: ┄CX LogP: 3.36CX LogD: -0.03Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -0.85
References 1. PubChem BioAssay data set,