SID26514325

ID: ALA2448605

PubChem CID: 69740920

Max Phase: Preclinical

Molecular Formula: C21H20N4O7

Molecular Weight: 440.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCn1c(=O)n(Cc2ccc([N+](=O)[O-])cc2)c(=O)n([C@@H](Cc2ccccc2)C(=O)O)c1=O

Standard InChI:  InChI=1S/C21H20N4O7/c1-2-22-19(28)23(13-15-8-10-16(11-9-15)25(31)32)21(30)24(20(22)29)17(18(26)27)12-14-6-4-3-5-7-14/h3-11,17H,2,12-13H2,1H3,(H,26,27)/t17-/m0/s1

Standard InChI Key:  CCLINJGMVNJMNW-KRWDZBQOSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  1  0  0  0  0  0999 V2000
    0.8763    1.0551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9816    1.0551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5527   -1.4199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1618    3.1176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8763    1.8801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1618   -4.3074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5908   -4.3074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5527    1.0551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1618   -0.1824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2671   -0.1824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8763   -3.8949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1618    0.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2671    0.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5527   -0.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5527    1.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8763   -0.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1618    2.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2671    2.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9816   -0.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8763   -1.4199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2671    3.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5908   -1.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1618   -1.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8763   -3.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5908   -2.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1618   -2.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9816   -1.4199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9816    3.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5527    3.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9816    4.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5527    4.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2671    4.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 12  2  0
  2 13  2  0
  3 14  2  0
  4 17  2  0
  5 17  1  0
  6 11  2  0
  7 11  1  0
  8 12  1  0
  8 13  1  0
  8 15  1  0
  9 12  1  0
  9 14  1  0
  9 16  1  0
 10 13  1  0
 10 14  1  0
 10 19  1  0
 11 24  1  0
 15 17  1  0
 15 18  1  1
 16 20  1  0
 18 21  1  0
 19 27  1  0
 20 22  2  0
 20 23  1  0
 21 28  2  0
 21 29  1  0
 22 25  1  0
 23 26  2  0
 24 25  2  0
 24 26  1  0
 28 30  1  0
 29 31  2  0
 30 32  2  0
 31 32  1  0
M  CHG  2   7  -1  11   1
M  END

Associated Targets(Human)

PTPN7 Tchem Protein-tyrosine phosphatase LC-PTP (886 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GAPDH Tchem Glyceraldehyde-3-phosphate dehydrogenase liver (1284 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Dusp6 Dual specificity protein phosphatase 6 (459 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.41Molecular Weight (Monoisotopic): 440.1332AlogP: 1.02#Rotatable Bonds: 8
Polar Surface Area: 146.44Molecular Species: ACIDHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.44CX Basic pKa: CX LogP: 3.36CX LogD: -0.03
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -0.85

References

1. PubChem BioAssay data set, 

Source

Source(1):