3-(1-(3,4-dichlorophenylsulfonyl)piperidin-4-yl)-5-(6-methoxyquinolin-4-yl)oxazolidin-2-one

ID: ALA245365

PubChem CID: 44439911

Max Phase: Preclinical

Molecular Formula: C24H23Cl2N3O5S

Molecular Weight: 536.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2nccc(C3CN(C4CCN(S(=O)(=O)c5ccc(Cl)c(Cl)c5)CC4)C(=O)O3)c2c1

Standard InChI:  InChI=1S/C24H23Cl2N3O5S/c1-33-16-2-5-22-19(12-16)18(6-9-27-22)23-14-29(24(30)34-23)15-7-10-28(11-8-15)35(31,32)17-3-4-20(25)21(26)13-17/h2-6,9,12-13,15,23H,7-8,10-11,14H2,1H3

Standard InChI Key:  CYWUOUYBLQTFGG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    2.1819  -21.1985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0069  -21.1950    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7401  -22.7273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0253  -23.1402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3088  -22.7269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3117  -21.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7389  -21.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0246  -21.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0266  -20.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7423  -20.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4574  -20.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4518  -21.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7484  -19.4222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4646  -19.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5983  -21.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8419  -21.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2914  -21.2036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7058  -20.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5123  -20.6638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3722  -19.7355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5333  -21.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9476  -21.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7688  -21.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7677  -20.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9403  -20.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8292  -21.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0035  -20.3700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0131  -22.0199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2413  -21.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0628  -21.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4719  -21.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0534  -20.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2333  -20.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4605  -19.7569    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.2968  -21.1828    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  4  5  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
  9 10  2  0
 18 20  2  0
  7  3  2  0
 17 21  1  0
 21 22  1  0
 10 11  1  0
  5  6  1  0
 11 12  2  0
 12  7  1  0
 21 25  1  0
 22 23  1  0
 23  1  1  0
  1 24  1  0
 24 25  1  0
  6  8  2  0
  2 26  1  0
  1  2  1  0
  2 27  2  0
 13 14  1  0
  2 28  2  0
 10 13  1  0
 26 29  2  0
  3  4  1  0
 29 30  1  0
 15  6  1  0
 30 31  2  0
 15 16  1  0
 31 32  1  0
  7  8  1  0
 32 33  2  0
 33 26  1  0
 32 34  1  0
  8  9  1  0
 31 35  1  0
M  END

Associated Targets(Human)

CCR8 Tchem C-C chemokine receptor type 8 (339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.44Molecular Weight (Monoisotopic): 535.0735AlogP: 4.90#Rotatable Bonds: 5
Polar Surface Area: 89.04Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.50CX LogP: 3.72CX LogD: 3.72
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -1.21

References

1. Jin J, Wang Y, Wang F, Kerns JK, Vinader VM, Hancock AP, Lindon MJ, Stevenson GI, Morrow DM, Rao P, Nguyen C, Barrett VJ, Browning C, Hartmann G, Andrew DP, Sarau HM, Foley JJ, Jurewicz AJ, Fornwald JA, Harker AJ, Moore ML, Rivero RA, Belmonte KE, Connor HE..  (2007)  Oxazolidinones as novel human CCR8 antagonists.,  17  (6): [PMID:17267215] [10.1016/j.bmcl.2006.12.076]

Source