The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-(3,4-dichlorophenylsulfonyl)piperidin-4-yl)-5-(6-methoxyquinolin-4-yl)oxazolidin-2-one ID: ALA245365
PubChem CID: 44439911
Max Phase: Preclinical
Molecular Formula: C24H23Cl2N3O5S
Molecular Weight: 536.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nccc(C3CN(C4CCN(S(=O)(=O)c5ccc(Cl)c(Cl)c5)CC4)C(=O)O3)c2c1
Standard InChI: InChI=1S/C24H23Cl2N3O5S/c1-33-16-2-5-22-19(12-16)18(6-9-27-22)23-14-29(24(30)34-23)15-7-10-28(11-8-15)35(31,32)17-3-4-20(25)21(26)13-17/h2-6,9,12-13,15,23H,7-8,10-11,14H2,1H3
Standard InChI Key: CYWUOUYBLQTFGG-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
2.1819 -21.1985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0069 -21.1950 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.7401 -22.7273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0253 -23.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3088 -22.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3117 -21.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7389 -21.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0246 -21.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0266 -20.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7423 -20.2518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4574 -20.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4518 -21.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7484 -19.4222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4646 -19.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5983 -21.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8419 -21.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2914 -21.2036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7058 -20.4901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5123 -20.6638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3722 -19.7355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5333 -21.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9476 -21.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7688 -21.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7677 -20.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9403 -20.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8292 -21.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0035 -20.3700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0131 -22.0199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2413 -21.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0628 -21.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4719 -21.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0534 -20.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2333 -20.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4605 -19.7569 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2968 -21.1828 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4 5 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
9 10 2 0
18 20 2 0
7 3 2 0
17 21 1 0
21 22 1 0
10 11 1 0
5 6 1 0
11 12 2 0
12 7 1 0
21 25 1 0
22 23 1 0
23 1 1 0
1 24 1 0
24 25 1 0
6 8 2 0
2 26 1 0
1 2 1 0
2 27 2 0
13 14 1 0
2 28 2 0
10 13 1 0
26 29 2 0
3 4 1 0
29 30 1 0
15 6 1 0
30 31 2 0
15 16 1 0
31 32 1 0
7 8 1 0
32 33 2 0
33 26 1 0
32 34 1 0
8 9 1 0
31 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.44Molecular Weight (Monoisotopic): 535.0735AlogP: 4.90#Rotatable Bonds: 5Polar Surface Area: 89.04Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.50CX LogP: 3.72CX LogD: 3.72Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -1.21
References 1. Jin J, Wang Y, Wang F, Kerns JK, Vinader VM, Hancock AP, Lindon MJ, Stevenson GI, Morrow DM, Rao P, Nguyen C, Barrett VJ, Browning C, Hartmann G, Andrew DP, Sarau HM, Foley JJ, Jurewicz AJ, Fornwald JA, Harker AJ, Moore ML, Rivero RA, Belmonte KE, Connor HE.. (2007) Oxazolidinones as novel human CCR8 antagonists., 17 (6): [PMID:17267215 ] [10.1016/j.bmcl.2006.12.076 ]