The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(4-hydroxy-3-isopropylphenoxy)-3,5-diisopropylbenzyl)thiazolidine-2,4-dione ID: ALA245462
PubChem CID: 44441147
Max Phase: Preclinical
Molecular Formula: C25H31NO4S
Molecular Weight: 441.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cc(Oc2c(C(C)C)cc(CC3SC(=O)NC3=O)cc2C(C)C)ccc1O
Standard InChI: InChI=1S/C25H31NO4S/c1-13(2)18-12-17(7-8-21(18)27)30-23-19(14(3)4)9-16(10-20(23)15(5)6)11-22-24(28)26-25(29)31-22/h7-10,12-15,22,27H,11H2,1-6H3,(H,26,28,29)
Standard InChI Key: MAVVKYQSGOSEET-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
6.5444 -17.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5432 -18.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2581 -18.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9716 -17.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2563 -16.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6846 -16.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4006 -17.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4003 -18.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1155 -18.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1079 -16.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8284 -18.4893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8298 -16.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8296 -16.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1155 -17.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8278 -17.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8290 -18.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5445 -18.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2580 -18.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0147 -18.3951 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.5607 -17.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1359 -17.0583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3418 -17.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7243 -16.6915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3818 -17.8605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9714 -18.0658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9833 -18.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1584 -18.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3911 -19.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0981 -15.9979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8076 -15.5769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3788 -15.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 14 1 0
15 16 1 0
3 25 2 0
6 7 1 0
1 2 2 0
16 17 1 0
7 8 2 0
18 17 1 0
25 4 1 0
8 9 1 0
9 16 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
18 19 1 0
15 10 2 0
22 23 2 0
10 7 1 0
20 24 2 0
4 5 2 0
2 11 1 0
8 26 1 0
5 1 1 0
26 27 1 0
1 12 1 0
26 28 1 0
2 3 1 0
10 29 1 0
12 13 1 0
29 30 1 0
4 6 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.59Molecular Weight (Monoisotopic): 441.1974AlogP: 6.45#Rotatable Bonds: 7Polar Surface Area: 75.63Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.61CX Basic pKa: ┄CX LogP: 6.88CX LogD: 6.06Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: 0.35
References 1. Haning H, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Bischoff H.. (2007) Novel heterocyclic thyromimetics. Part 2., 17 (14): [PMID:17499989 ] [10.1016/j.bmcl.2007.04.085 ]