5-(4-hydroxy-3-isopropylphenoxy)benzofuran-2-carboxylic acid

ID: ALA245504

PubChem CID: 44441125

Max Phase: Preclinical

Molecular Formula: C18H16O5

Molecular Weight: 312.32

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)c1cc(Oc2ccc3oc(C(=O)O)cc3c2)ccc1O

Standard InChI:  InChI=1S/C18H16O5/c1-10(2)14-9-13(3-5-15(14)19)22-12-4-6-16-11(7-12)8-17(23-16)18(20)21/h3-10,19H,1-2H3,(H,20,21)

Standard InChI Key:  UVMZHKLHOZBKQX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -3.6425    2.8746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6437    2.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9290    1.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2126    2.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2155    2.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9308    3.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5027    3.2935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7867    2.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7870    2.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0720    1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0796    3.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3585    1.6355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3571    3.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3573    4.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0712    2.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4229    3.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6361    2.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6415    2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4325    1.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9134    2.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7382    2.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1572    1.7894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1442    3.2181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17 11  2  0
 11  8  1  0
  5  6  2  0
  2 12  1  0
  6  1  1  0
  1 13  1  0
  1  2  2  0
 13 14  1  0
  5  7  1  0
 13 15  1  0
 17 18  1  0
  3  4  2  0
  7  8  1  0
  8  9  2  0
  4  5  1  0
 16 17  1  0
 18 19  1  0
 19 20  1  0
 20 16  2  0
  9 10  1  0
 20 21  1  0
 10 18  2  0
 21 22  1  0
  2  3  1  0
 21 23  2  0
M  END

Associated Targets(Human)

THRA Tclin Thyroid hormone receptor (146 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 312.32Molecular Weight (Monoisotopic): 312.0998AlogP: 4.75#Rotatable Bonds: 4
Polar Surface Area: 79.90Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.10CX Basic pKa: CX LogP: 4.15CX LogD: 0.69
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.73Np Likeness Score: 0.08

References

1. Haning H, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Bischoff H..  (2007)  Novel heterocyclic thyromimetics. Part 2.,  17  (14): [PMID:17499989] [10.1016/j.bmcl.2007.04.085]

Source