The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-((6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)methyl)-7-methoxybenzofuran-2-yl)-N-propylbenzamide ID: ALA247057
PubChem CID: 44438156
Max Phase: Preclinical
Molecular Formula: C31H34N2O5
Molecular Weight: 514.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)c1cccc(-c2cc3c(CN4CCc5cc(OC)c(OC)cc5C4)ccc(OC)c3o2)c1
Standard InChI: InChI=1S/C31H34N2O5/c1-5-12-32-31(34)22-8-6-7-21(14-22)27-17-25-23(9-10-26(35-2)30(25)38-27)18-33-13-11-20-15-28(36-3)29(37-4)16-24(20)19-33/h6-10,14-17H,5,11-13,18-19H2,1-4H3,(H,32,34)
Standard InChI Key: CLXDZRSCENQCJO-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
10.0902 1.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0891 1.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8039 0.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8021 2.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5175 1.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5224 1.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3142 0.8746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7988 1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3063 2.2192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8030 -0.1110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5170 -0.5243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5183 -1.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2282 -1.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2340 -0.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9485 -0.5255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9433 -1.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6520 -1.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3664 -1.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3676 -0.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6583 -0.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0819 -0.1209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0776 -1.7670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7934 -1.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7971 3.1885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0814 3.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6238 1.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7944 -0.5368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0379 0.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8621 0.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2712 1.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8500 2.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0272 2.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2558 2.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0807 3.0065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8365 3.7093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4999 2.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3249 2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7441 1.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 2 0
8 9 1 0
18 19 1 0
9 5 1 0
19 20 2 0
20 15 1 0
4 1 2 0
19 21 1 0
3 10 1 0
5 6 2 0
22 23 1 0
18 22 1 0
10 11 1 0
11 12 1 0
24 25 1 0
4 24 1 0
8 26 1 0
2 3 2 0
21 27 1 0
3 6 1 0
26 28 2 0
11 14 1 0
28 29 1 0
12 13 1 0
29 30 2 0
13 16 1 0
30 31 1 0
15 14 1 0
31 32 2 0
32 26 1 0
1 2 1 0
31 33 1 0
5 4 1 0
33 34 1 0
15 16 2 0
33 35 2 0
6 7 1 0
34 36 1 0
16 17 1 0
36 37 1 0
7 8 2 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.62Molecular Weight (Monoisotopic): 514.2468AlogP: 5.82#Rotatable Bonds: 9Polar Surface Area: 73.17Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.63CX LogP: 4.89CX LogD: 4.46Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -0.63
References 1. Hagihara K, Kashima H, Iida K, Enokizono J, Uchida S, Nonaka H, Kurokawa M, Shimada J.. (2007) Novel 4-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-yl)methylbenzofuran derivatives as selective alpha(2C)-adrenergic receptor antagonists., 17 (6): [PMID:17257841 ] [10.1016/j.bmcl.2006.12.094 ]