The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{2-[5-Amino-2-(3-chloro-phenyl)-6-oxo-6H-pyrimidin-1-yl]-acetylamino}-2,2-difluoro-3-oxo-5-phenyl-pentanoic acid benzylamide ID: ALA24734
PubChem CID: 9916581
Max Phase: Preclinical
Molecular Formula: C30H26ClF2N5O4
Molecular Weight: 594.02
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1cnc(-c2cccc(Cl)c2)n(CC(=O)NC(Cc2ccccc2)C(=O)C(F)(F)C(=O)NCc2ccccc2)c1=O
Standard InChI: InChI=1S/C30H26ClF2N5O4/c31-22-13-7-12-21(15-22)27-35-17-23(34)28(41)38(27)18-25(39)37-24(14-19-8-3-1-4-9-19)26(40)30(32,33)29(42)36-16-20-10-5-2-6-11-20/h1-13,15,17,24H,14,16,18,34H2,(H,36,42)(H,37,39)
Standard InChI Key: NUNGDKUJSAHDEV-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
3.4000 -3.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4875 -4.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4042 -3.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8792 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8917 -2.7792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3542 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -4.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -3.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3667 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0000 -3.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4167 -4.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9375 -3.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6042 -3.8000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -3.2042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8750 -4.5875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -4.4042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4500 -4.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -4.4000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0000 -3.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4167 -4.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8375 -3.9750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1167 -4.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4542 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -5.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4500 -1.3042 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.6375 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4417 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9667 -2.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9667 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9625 -5.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4792 -4.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6375 -3.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1542 -4.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0000 -5.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1542 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6667 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4750 -5.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6667 -3.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9917 -5.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 1 1 0
5 8 1 0
6 3 2 0
7 4 1 0
8 14 1 0
9 2 1 0
10 7 2 0
11 3 1 0
12 1 1 0
13 12 1 0
14 13 1 0
15 9 1 0
16 5 2 0
17 4 2 0
18 2 1 0
19 8 1 0
20 2 1 0
21 11 1 0
22 9 2 0
23 13 2 0
24 7 1 0
25 15 1 0
26 21 2 0
27 19 1 0
28 26 1 0
29 25 1 0
30 11 2 0
31 30 1 0
32 31 2 0
33 27 2 0
34 27 1 0
35 29 1 0
36 29 2 0
37 34 2 0
38 35 2 0
39 36 1 0
40 33 1 0
41 39 2 0
42 37 1 0
6 10 1 0
32 26 1 0
40 42 2 0
41 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.02Molecular Weight (Monoisotopic): 593.1641AlogP: 3.39#Rotatable Bonds: 11Polar Surface Area: 136.18Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.56CX Basic pKa: 0.55CX LogP: 4.02CX LogD: 4.01Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -0.99
References 1. Akahoshi F, Ashimori A, Sakashita H, Yoshimura T, Eda M, Imada T, Nakajima M, Mitsutomi N, Kuwahara S, Ohtsuka T, Fukaya C, Miyazaki M, Nakamura N.. (2001) Synthesis, structure-activity relationships, and pharmacokinetic profiles of nonpeptidic difluoromethylene ketones as novel inhibitors of human chymase., 44 (8): [PMID:11312928 ] [10.1021/jm000497n ]