The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)methyl)-7-methoxy-N-propylbenzofuran-2-carboxamide ID: ALA247466
PubChem CID: 44438162
Max Phase: Preclinical
Molecular Formula: C25H30N2O5
Molecular Weight: 438.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)c1cc2c(CN3CCc4cc(OC)c(OC)cc4C3)ccc(OC)c2o1
Standard InChI: InChI=1S/C25H30N2O5/c1-5-9-26-25(28)23-13-19-17(6-7-20(29-2)24(19)32-23)14-27-10-8-16-11-21(30-3)22(31-4)12-18(16)15-27/h6-7,11-13H,5,8-10,14-15H2,1-4H3,(H,26,28)
Standard InChI Key: WLTYJVBUSNBYAD-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
11.1902 -4.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1891 -4.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9039 -5.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9021 -3.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6175 -4.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6224 -4.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4142 -5.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8988 -4.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4063 -3.8100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9030 -6.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6170 -6.5535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6183 -7.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3282 -7.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3340 -6.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0485 -6.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0433 -7.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7520 -7.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4664 -7.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4676 -6.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7583 -6.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1819 -6.1501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1776 -7.7961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8934 -7.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8971 -2.8407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1814 -2.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8944 -6.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7238 -4.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1405 -5.1865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1321 -3.7576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9571 -3.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3653 -3.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1903 -3.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
5 4 1 0
15 16 2 0
6 7 1 0
16 17 1 0
7 8 2 0
17 18 2 0
8 9 1 0
18 19 1 0
9 5 1 0
19 20 2 0
20 15 1 0
4 1 2 0
19 21 1 0
3 10 1 0
5 6 2 0
22 23 1 0
18 22 1 0
10 11 1 0
11 12 1 0
24 25 1 0
4 24 1 0
21 26 1 0
2 3 2 0
8 27 1 0
3 6 1 0
27 28 2 0
11 14 1 0
27 29 1 0
12 13 1 0
29 30 1 0
13 16 1 0
30 31 1 0
15 14 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.52Molecular Weight (Monoisotopic): 438.2155AlogP: 4.16#Rotatable Bonds: 8Polar Surface Area: 73.17Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.24CX LogP: 3.24CX LogD: 3.01Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -0.84
References 1. Hagihara K, Kashima H, Iida K, Enokizono J, Uchida S, Nonaka H, Kurokawa M, Shimada J.. (2007) Novel 4-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-yl)methylbenzofuran derivatives as selective alpha(2C)-adrenergic receptor antagonists., 17 (6): [PMID:17257841 ] [10.1016/j.bmcl.2006.12.094 ]