The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)methyl)-N-(2-hydroxyethyl)-7-methoxybenzofuran-2-carboxamide ID: ALA247467
PubChem CID: 44438163
Max Phase: Preclinical
Molecular Formula: C24H28N2O6
Molecular Weight: 440.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(Cc1ccc(OC)c3oc(C(=O)NCCO)cc13)CC2
Standard InChI: InChI=1S/C24H28N2O6/c1-29-19-5-4-16(18-12-22(32-23(18)19)24(28)25-7-9-27)13-26-8-6-15-10-20(30-2)21(31-3)11-17(15)14-26/h4-5,10-12,27H,6-9,13-14H2,1-3H3,(H,25,28)
Standard InChI Key: PPZVXGFCJBVSNP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-5.2264 -10.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2276 -11.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5128 -11.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5146 -9.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7992 -10.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7943 -11.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0024 -11.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5179 -10.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0103 -10.0850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5137 -12.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7997 -12.8285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7984 -13.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0885 -14.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0826 -12.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3682 -12.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3734 -13.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6647 -14.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9503 -13.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9491 -12.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6584 -12.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2348 -12.4251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2391 -14.0711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4768 -13.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5195 -9.1157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2352 -8.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4778 -12.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6929 -10.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2762 -11.4615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2846 -10.0326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4596 -10.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0513 -9.3108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7737 -9.3059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
5 4 1 0
15 16 2 0
6 7 1 0
16 17 1 0
7 8 2 0
17 18 2 0
8 9 1 0
18 19 1 0
9 5 1 0
19 20 2 0
20 15 1 0
4 1 2 0
19 21 1 0
3 10 1 0
5 6 2 0
22 23 1 0
18 22 1 0
10 11 1 0
11 12 1 0
24 25 1 0
4 24 1 0
21 26 1 0
2 3 2 0
8 27 1 0
3 6 1 0
27 28 2 0
11 14 1 0
27 29 1 0
12 13 1 0
29 30 1 0
13 16 1 0
30 31 1 0
15 14 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.50Molecular Weight (Monoisotopic): 440.1947AlogP: 2.74#Rotatable Bonds: 8Polar Surface Area: 93.40Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.24CX LogP: 1.67CX LogD: 1.44Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -0.65
References 1. Hagihara K, Kashima H, Iida K, Enokizono J, Uchida S, Nonaka H, Kurokawa M, Shimada J.. (2007) Novel 4-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-yl)methylbenzofuran derivatives as selective alpha(2C)-adrenergic receptor antagonists., 17 (6): [PMID:17257841 ] [10.1016/j.bmcl.2006.12.094 ]