The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-dibromo-5-(3-(4-fluorobenzoyl)-4-hydroxyphenoxy)benzofuran-2-carboxylic acid ID: ALA247912
PubChem CID: 22228633
Max Phase: Preclinical
Molecular Formula: C22H11Br2FO6
Molecular Weight: 550.13
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc2c(Br)c(Oc3ccc(O)c(C(=O)c4ccc(F)cc4)c3)c(Br)cc2o1
Standard InChI: InChI=1S/C22H11Br2FO6/c23-15-9-17-14(8-18(31-17)22(28)29)19(24)21(15)30-12-5-6-16(26)13(7-12)20(27)10-1-3-11(25)4-2-10/h1-9,26H,(H,28,29)
Standard InChI Key: GIYRXPZCGDUAFM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
7.4652 -8.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4641 -9.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1789 -10.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8953 -9.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8925 -8.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1771 -8.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6054 -8.3936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3214 -8.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3212 -9.6261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0363 -10.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0287 -8.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7493 -10.0518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7507 -8.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7505 -7.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5314 -8.5311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7445 -8.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7499 -9.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5411 -9.8706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0219 -9.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8469 -9.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2659 -9.8979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2529 -8.4690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6073 -10.0397 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
6.0363 -8.8128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4673 -7.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4674 -6.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7523 -5.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0356 -6.3445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0390 -7.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7510 -5.1024 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0213 -7.5604 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
5 7 1 0
3 4 2 0
7 8 1 0
8 9 2 0
15 16 1 0
17 18 1 0
18 19 1 0
19 15 2 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 1 0
10 17 2 0
20 22 2 0
2 3 1 0
9 23 1 0
16 11 2 0
13 24 2 0
11 8 1 0
14 25 2 0
5 6 2 0
25 26 1 0
2 12 1 0
26 27 2 0
6 1 1 0
27 28 1 0
1 13 1 0
28 29 2 0
29 14 1 0
1 2 2 0
27 30 1 0
13 14 1 0
11 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.13Molecular Weight (Monoisotopic): 547.8906AlogP: 6.52#Rotatable Bonds: 5Polar Surface Area: 96.97Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.10CX Basic pKa: ┄CX LogP: 6.70CX LogD: 2.89Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.27Np Likeness Score: -0.32
References 1. Haning H, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Bischoff H.. (2007) Novel heterocyclic thyromimetics. Part 2., 17 (14): [PMID:17499989 ] [10.1016/j.bmcl.2007.04.085 ]