The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 4-(2-((1S,5R,6s)-6-((R)-2-cyclopentyl-2-hydroxy-2-phenylacetamido)-3-aza-bicyclo[3.1.0]hexan-3-yl)ethyl)benzoate ID: ALA249204
PubChem CID: 10344314
Max Phase: Preclinical
Molecular Formula: C28H34N2O4
Molecular Weight: 462.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(CCN2C[C@@H]3[C@H](C2)[C@H]3NC(=O)C(O)(c2ccccc2)C2CCCC2)cc1
Standard InChI: InChI=1S/C28H34N2O4/c1-34-26(31)20-13-11-19(12-14-20)15-16-30-17-23-24(18-30)25(23)29-27(32)28(33,22-9-5-6-10-22)21-7-3-2-4-8-21/h2-4,7-8,11-14,22-25,33H,5-6,9-10,15-18H2,1H3,(H,29,32)/t23-,24+,25+,28?
Standard InChI Key: YGHIXHGNVUQBRE-BKWJHWGASA-N
Molfile:
RDKit 2D
36 40 0 0 1 0 0 0 0 0999 V2000
12.2850 -25.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7624 -24.8530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2665 -24.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4973 -25.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4905 -24.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7834 -24.8787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9584 -24.8856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5519 -25.6034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7269 -25.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9703 -26.3144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9000 -25.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4937 -24.8826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6676 -24.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2480 -25.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6606 -26.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4854 -26.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7285 -24.7853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5873 -24.8404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4917 -26.1042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.4833 -23.6375 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.7306 -26.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0634 -26.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3186 -27.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1437 -27.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3982 -26.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0107 -25.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8356 -25.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2540 -26.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0781 -26.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4804 -25.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0526 -24.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2298 -24.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3069 -25.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7312 -26.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7074 -24.7774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3307 -26.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 17 1 0
7 8 1 0
2 18 1 0
5 4 1 0
4 19 1 6
8 9 1 0
5 20 1 6
21 22 1 0
6 5 1 0
8 10 2 0
4 6 1 0
9 11 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 21 1 0
9 21 1 0
11 12 2 0
18 26 1 0
4 1 1 0
26 27 1 0
12 13 1 0
27 28 2 0
1 2 1 0
28 29 1 0
13 14 2 0
29 30 2 0
2 3 1 0
30 31 1 0
14 15 1 0
31 32 2 0
32 27 1 0
6 7 1 6
15 16 2 0
16 11 1 0
33 34 1 0
33 35 2 0
30 33 1 0
3 5 1 0
34 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.59Molecular Weight (Monoisotopic): 462.2519AlogP: 3.14#Rotatable Bonds: 8Polar Surface Area: 78.87Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.98CX Basic pKa: 8.64CX LogP: 3.71CX LogD: 2.44Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.59Np Likeness Score: -0.30
References 1. Kumar N, Kaur K, Aeron S, Dharmarajan S, Silamkoti AD, Mehta A, Gupta S, Chugh A, Gupta JB, Salman M, Palle VP, Cliffe IA.. (2007) Synthesis and optimization of novel and selective muscarinic M(3) receptor antagonists., 17 (18): [PMID:17629699 ] [10.1016/j.bmcl.2007.06.081 ]