amphidinolide H

ID: ALA249688

PubChem CID: 10769258

Max Phase: Preclinical

Molecular Formula: C32H50O8

Molecular Weight: 562.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Amphidinolide H | amphidinolide H|CHEMBL249688

Canonical SMILES:  C=C1/C=C(\C)[C@@H](C)C[C@H](O)CC(=O)[C@H](O)[C@@H](O)[C@H](C)C[C@H](CO)OC(=O)/C(C)=C/CC/C=C/[C@@H]2O[C@H]2C[C@H](C)C1

Standard InChI:  InChI=1S/C32H50O8/c1-19-12-20(2)14-29-28(40-29)11-9-7-8-10-21(3)32(38)39-26(18-33)16-24(6)30(36)31(37)27(35)17-25(34)15-23(5)22(4)13-19/h9-11,13,20,23-26,28-31,33-34,36-37H,1,7-8,12,14-18H2,2-6H3/b11-9+,21-10+,22-13+/t20-,23+,24-,25+,26-,28+,29+,30+,31+/m1/s1

Standard InChI Key:  XDBPWFXFEXURRX-BNWMDRMVSA-N

Molfile:  

     RDKit          2D

 42 43  0  0  1  0  0  0  0  0999 V2000
    4.2584   -2.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9728   -2.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9728   -1.4708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6873   -2.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4018   -2.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1163   -2.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4018   -1.4708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1163   -3.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8307   -2.2958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4018   -3.9458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8307   -3.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8307   -4.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5452   -3.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5452   -5.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5452   -6.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2597   -4.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8307   -6.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8307   -7.2458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1163   -6.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1163   -5.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4018   -6.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6873   -6.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9728   -6.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2584   -6.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5439   -6.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4005   -6.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4005   -5.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6860   -4.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1150   -4.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1150   -3.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8294   -3.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4005   -3.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8294   -2.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5439   -2.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1150   -2.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5439   -1.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8294   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1150   -6.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8332   -6.8311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9741   -5.1833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0417   -5.2000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6958   -7.1292    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  8 10  1  6
 19 21  2  0
  4  5  1  0
 21 22  1  0
  8 11  1  0
 22 23  1  0
 23 24  1  0
 11 12  1  0
 24 25  2  0
 25 37  1  0
  5  6  1  0
 38 26  1  0
 11 13  1  6
 26 27  1  0
  2  3  1  6
 27 28  1  6
 12 14  1  0
 27 29  1  0
  5  7  2  0
 29 30  1  0
 14 15  1  0
 30 31  1  0
  1  2  1  0
 30 32  2  0
 14 16  1  6
 31 33  2  0
  6  8  1  0
 33 34  1  0
 15 17  1  0
 33 35  1  0
  2  4  1  0
 34 36  1  1
 38 37  1  0
 38 39  1  0
 37 39  1  0
 17 18  2  0
  6  9  1  6
 17 19  1  0
  1 34  1  0
 16 40  1  0
 37 41  1  1
 19 20  1  0
 38 42  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

DG-75 (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 562.74Molecular Weight (Monoisotopic): 562.3506AlogP: 3.97#Rotatable Bonds: 1
Polar Surface Area: 136.82Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.41CX Basic pKa: CX LogP: 4.38CX LogD: 4.38
Aromatic Rings: Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: 2.72

References

1. Oguchi K, Tsuda M, Iwamoto R, Okamoto Y, Endo T, Kobayashi J, Ozawa T, Masuda A..  (2007)  Amphidinolides B6 and B7, cytotoxic macrolides from a symbiotic dinoflagellate Amphidinium species.,  70  (10): [PMID:17922551] [10.1021/np0703085]

Source