The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
amphidinolide H ID: ALA249688
PubChem CID: 10769258
Max Phase: Preclinical
Molecular Formula: C32H50O8
Molecular Weight: 562.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Amphidinolide H | amphidinolide H|CHEMBL249688
Canonical SMILES: C=C1/C=C(\C)[C@@H](C)C[C@H](O)CC(=O)[C@H](O)[C@@H](O)[C@H](C)C[C@H](CO)OC(=O)/C(C)=C/CC/C=C/[C@@H]2O[C@H]2C[C@H](C)C1
Standard InChI: InChI=1S/C32H50O8/c1-19-12-20(2)14-29-28(40-29)11-9-7-8-10-21(3)32(38)39-26(18-33)16-24(6)30(36)31(37)27(35)17-25(34)15-23(5)22(4)13-19/h9-11,13,20,23-26,28-31,33-34,36-37H,1,7-8,12,14-18H2,2-6H3/b11-9+,21-10+,22-13+/t20-,23+,24-,25+,26-,28+,29+,30+,31+/m1/s1
Standard InChI Key: XDBPWFXFEXURRX-BNWMDRMVSA-N
Molfile:
RDKit 2D
42 43 0 0 1 0 0 0 0 0999 V2000
4.2584 -2.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9728 -2.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9728 -1.4708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6873 -2.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4018 -2.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1163 -2.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4018 -1.4708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1163 -3.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8307 -2.2958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4018 -3.9458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8307 -3.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8307 -4.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5452 -3.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5452 -5.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5452 -6.0083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2597 -4.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8307 -6.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8307 -7.2458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1163 -6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1163 -5.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4018 -6.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6873 -6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9728 -6.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2584 -6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5439 -6.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4005 -6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4005 -5.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6860 -4.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1150 -4.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1150 -3.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8294 -3.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4005 -3.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8294 -2.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5439 -2.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1150 -2.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5439 -1.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8294 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1150 -6.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8332 -6.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9741 -5.1833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 -5.2000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.6958 -7.1292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8 10 1 6
19 21 2 0
4 5 1 0
21 22 1 0
8 11 1 0
22 23 1 0
23 24 1 0
11 12 1 0
24 25 2 0
25 37 1 0
5 6 1 0
38 26 1 0
11 13 1 6
26 27 1 0
2 3 1 6
27 28 1 6
12 14 1 0
27 29 1 0
5 7 2 0
29 30 1 0
14 15 1 0
30 31 1 0
1 2 1 0
30 32 2 0
14 16 1 6
31 33 2 0
6 8 1 0
33 34 1 0
15 17 1 0
33 35 1 0
2 4 1 0
34 36 1 1
38 37 1 0
38 39 1 0
37 39 1 0
17 18 2 0
6 9 1 6
17 19 1 0
1 34 1 0
16 40 1 0
37 41 1 1
19 20 1 0
38 42 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.74Molecular Weight (Monoisotopic): 562.3506AlogP: 3.97#Rotatable Bonds: 1Polar Surface Area: 136.82Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.41CX Basic pKa: ┄CX LogP: 4.38CX LogD: 4.38Aromatic Rings: ┄Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: 2.72
References 1. Oguchi K, Tsuda M, Iwamoto R, Okamoto Y, Endo T, Kobayashi J, Ozawa T, Masuda A.. (2007) Amphidinolides B6 and B7, cytotoxic macrolides from a symbiotic dinoflagellate Amphidinium species., 70 (10): [PMID:17922551 ] [10.1021/np0703085 ]