The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((4-benzyl-1-piperazinyl)methyl)-6-(3-(4-methoxyphenyl)-2-propenoyl)-2(3H)-benzoxazolone ID: ALA250377
PubChem CID: 24745063
Max Phase: Preclinical
Molecular Formula: C29H29N3O4
Molecular Weight: 483.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/C(=O)c2ccc3c(c2)oc(=O)n3CN2CCN(Cc3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C29H29N3O4/c1-35-25-11-7-22(8-12-25)9-14-27(33)24-10-13-26-28(19-24)36-29(34)32(26)21-31-17-15-30(16-18-31)20-23-5-3-2-4-6-23/h2-14,19H,15-18,20-21H2,1H3/b14-9+
Standard InChI Key: WTLTVOHJEMEDDW-NTEUORMPSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-4.0033 -26.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0045 -26.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2894 -27.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5725 -26.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5754 -26.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2912 -25.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8571 -27.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1430 -26.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4275 -27.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2866 -26.9187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4262 -28.1579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0009 -27.3316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9932 -25.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2824 -26.0963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7136 -26.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7114 -26.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4952 -27.1743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9820 -26.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4989 -25.8395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8074 -26.5105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7183 -25.6834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7185 -24.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7561 -25.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5640 -24.8859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1083 -25.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9131 -25.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1744 -24.5532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6246 -23.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8135 -24.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9829 -24.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2389 -23.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0434 -23.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2995 -22.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7524 -22.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9461 -22.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6937 -23.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
4 5 1 0
18 20 2 0
9 10 1 0
1 21 1 0
2 3 1 0
21 22 1 0
9 11 2 0
19 23 1 0
5 6 2 0
23 24 1 0
24 25 1 0
10 12 2 0
12 16 1 0
6 1 1 0
15 13 1 0
1 2 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
13 14 2 0
27 30 1 0
14 10 1 0
31 30 1 0
15 16 2 0
31 32 2 0
4 7 1 0
32 33 1 0
3 4 2 0
33 34 2 0
7 8 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.57Molecular Weight (Monoisotopic): 483.2158AlogP: 4.27#Rotatable Bonds: 8Polar Surface Area: 67.92Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.55CX LogP: 4.66CX LogD: 4.27Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -1.00
References 1. Ivanova Y, Momekov G, Petrov O, Karaivanova M, Kalcheva V.. (2007) Cytotoxic Mannich bases of 6-(3-aryl-2-propenoyl)-2(3H)-benzoxazolones., 42 (11): [PMID:17459529 ] [10.1016/j.ejmech.2007.02.019 ]